About 1,5-dipentyltetrazole
1,5-dipentyltetrazole (PubChem CID 23279536) has the molecular formula C11H22N4
and a molecular weight of 210.32 g/mol. Its IUPAC name is 1,5-dipentyltetrazole.
Molecular Properties
| Compound Name | 1,5-dipentyltetrazole |
| PubChem CID | 23279536 |
| Molecular Formula | C11H22N4 |
| Molecular Weight | 210.32 g/mol |
| Exact Mass | 210.18 |
| IUPAC Name | 1,5-dipentyltetrazole |
| SMILES | CCCCCc1nnnn1CCCCC |
| InChI | InChI=1S/C11H22N4/c1-3-5-7-9-11-12-13-14-15(11)10-8-6-4-2/h3-10H2,1-2H3 |
| InChIKey | VJJJMGBTCSYSAL-UHFFFAOYSA-N |
| XLogP | 2.60 |
| TPSA | 43.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 210.32 |
| LogP ≤ 5 | 2.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 1,5-dipentyltetrazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1,5-dipentyltetrazole?
The IUPAC name of 1,5-dipentyltetrazole (CID 23279536) is 1,5-dipentyltetrazole.
What is the SMILES notation for 1,5-dipentyltetrazole?
The canonical SMILES for 1,5-dipentyltetrazole is CCCCCc1nnnn1CCCCC.
What is the InChIKey of 1,5-dipentyltetrazole?
The InChIKey is VJJJMGBTCSYSAL-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H22N4/c1-3-5-7-9-11-12-13-14-15(11)10-8-6-4-2/h3-10H2,1-2H3.
What are the key properties of 1,5-dipentyltetrazole?
1,5-dipentyltetrazole has a molecular weight of 210.32 g/mol, XLogP of 2.60, 8 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 1,5-dipentyltetrazole is sourced from PubChem (CID 23279536), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).