About N-[4-(2-oxo-3H-1,3-thiazol-4-yl)phenyl]acetamide
N-[4-(2-oxo-3H-1,3-thiazol-4-yl)phenyl]acetamide (PubChem CID 23279717) has the molecular formula C11H10N2O2S
and a molecular weight of 234.28 g/mol. Its IUPAC name is N-[4-(2-oxo-3H-1,3-thiazol-4-yl)phenyl]acetamide.
Molecular Properties
| Compound Name | N-[4-(2-oxo-3H-1,3-thiazol-4-yl)phenyl]acetamide |
| PubChem CID | 23279717 |
| Molecular Formula | C11H10N2O2S |
| Molecular Weight | 234.28 g/mol |
| Exact Mass | 234.05 |
| IUPAC Name | N-[4-(2-oxo-3H-1,3-thiazol-4-yl)phenyl]acetamide |
| SMILES | CC(=O)Nc1ccc(-c2csc(=O)[nH]2)cc1 |
| InChI | InChI=1S/C11H10N2O2S/c1-7(14)12-9-4-2-8(3-5-9)10-6-16-11(15)13-10/h2-6H,1H3,(H,12,14)(H,13,15) |
| InChIKey | WVSKXNWZVYCKCH-UHFFFAOYSA-N |
| XLogP | 2.06 |
| TPSA | 61.96 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 234.28 |
| LogP ≤ 5 | 2.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze N-[4-(2-oxo-3H-1,3-thiazol-4-yl)phenyl]acetamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[4-(2-oxo-3H-1,3-thiazol-4-yl)phenyl]acetamide?
The IUPAC name of N-[4-(2-oxo-3H-1,3-thiazol-4-yl)phenyl]acetamide (CID 23279717) is N-[4-(2-oxo-3H-1,3-thiazol-4-yl)phenyl]acetamide.
What is the SMILES notation for N-[4-(2-oxo-3H-1,3-thiazol-4-yl)phenyl]acetamide?
The canonical SMILES for N-[4-(2-oxo-3H-1,3-thiazol-4-yl)phenyl]acetamide is CC(=O)Nc1ccc(-c2csc(=O)[nH]2)cc1.
What is the InChIKey of N-[4-(2-oxo-3H-1,3-thiazol-4-yl)phenyl]acetamide?
The InChIKey is WVSKXNWZVYCKCH-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H10N2O2S/c1-7(14)12-9-4-2-8(3-5-9)10-6-16-11(15)13-10/h2-6H,1H3,(H,12,14)(H,13,15).
What are the key properties of N-[4-(2-oxo-3H-1,3-thiazol-4-yl)phenyl]acetamide?
N-[4-(2-oxo-3H-1,3-thiazol-4-yl)phenyl]acetamide has a molecular weight of 234.28 g/mol, XLogP of 2.06, 2 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N-[4-(2-oxo-3H-1,3-thiazol-4-yl)phenyl]acetamide is sourced from PubChem (CID 23279717), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).