About 2-[2-(3,5-dimethylpyrazol-1-yl)ethyl]-4-(4-fluorophenyl)-1,3-thiazole
2-[2-(3,5-dimethylpyrazol-1-yl)ethyl]-4-(4-fluorophenyl)-1,3-thiazole (PubChem CID 2327977) has the molecular formula C16H16FN3S
and a molecular weight of 301.39 g/mol. Its IUPAC name is 2-[2-(3,5-dimethylpyrazol-1-yl)ethyl]-4-(4-fluorophenyl)-1,3-thiazole.
Molecular Properties
| Compound Name | 2-[2-(3,5-dimethylpyrazol-1-yl)ethyl]-4-(4-fluorophenyl)-1,3-thiazole |
| PubChem CID | 2327977 |
| Molecular Formula | C16H16FN3S |
| Molecular Weight | 301.39 g/mol |
| Exact Mass | 301.10 |
| IUPAC Name | 2-[2-(3,5-dimethylpyrazol-1-yl)ethyl]-4-(4-fluorophenyl)-1,3-thiazole |
| SMILES | Cc1cc(C)n(CCc2nc(-c3ccc(F)cc3)cs2)n1 |
| InChI | InChI=1S/C16H16FN3S/c1-11-9-12(2)20(19-11)8-7-16-18-15(10-21-16)13-3-5-14(17)6-4-13/h3-6,9-10H,7-8H2,1-2H3 |
| InChIKey | WXMUNVSKQFXTDG-UHFFFAOYSA-N |
| XLogP | 4.01 |
| TPSA | 30.71 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 301.39 |
| LogP ≤ 5 | 4.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 2-[2-(3,5-dimethylpyrazol-1-yl)ethyl]-4-(4-fluorophenyl)-1,3-thiazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[2-(3,5-dimethylpyrazol-1-yl)ethyl]-4-(4-fluorophenyl)-1,3-thiazole?
The IUPAC name of 2-[2-(3,5-dimethylpyrazol-1-yl)ethyl]-4-(4-fluorophenyl)-1,3-thiazole (CID 2327977) is 2-[2-(3,5-dimethylpyrazol-1-yl)ethyl]-4-(4-fluorophenyl)-1,3-thiazole.
What is the SMILES notation for 2-[2-(3,5-dimethylpyrazol-1-yl)ethyl]-4-(4-fluorophenyl)-1,3-thiazole?
The canonical SMILES for 2-[2-(3,5-dimethylpyrazol-1-yl)ethyl]-4-(4-fluorophenyl)-1,3-thiazole is Cc1cc(C)n(CCc2nc(-c3ccc(F)cc3)cs2)n1.
What is the InChIKey of 2-[2-(3,5-dimethylpyrazol-1-yl)ethyl]-4-(4-fluorophenyl)-1,3-thiazole?
The InChIKey is WXMUNVSKQFXTDG-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H16FN3S/c1-11-9-12(2)20(19-11)8-7-16-18-15(10-21-16)13-3-5-14(17)6-4-13/h3-6,9-10H,7-8H2,1-2H3.
What are the key properties of 2-[2-(3,5-dimethylpyrazol-1-yl)ethyl]-4-(4-fluorophenyl)-1,3-thiazole?
2-[2-(3,5-dimethylpyrazol-1-yl)ethyl]-4-(4-fluorophenyl)-1,3-thiazole has a molecular weight of 301.39 g/mol, XLogP of 4.01, 4 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[2-(3,5-dimethylpyrazol-1-yl)ethyl]-4-(4-fluorophenyl)-1,3-thiazole is sourced from PubChem (CID 2327977), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).