About (2R,3S)-3-phenyl-2-propyl-1,3-oxaphospholan-5-one
(2R,3S)-3-phenyl-2-propyl-1,3-oxaphospholan-5-one (PubChem CID 23280168) has the molecular formula C12H15O2P
and a molecular weight of 222.22 g/mol. Its IUPAC name is (2R,3S)-3-phenyl-2-propyl-1,3-oxaphospholan-5-one.
Molecular Properties
| Compound Name | (2R,3S)-3-phenyl-2-propyl-1,3-oxaphospholan-5-one |
| PubChem CID | 23280168 |
| Molecular Formula | C12H15O2P |
| Molecular Weight | 222.22 g/mol |
| Exact Mass | 222.08 |
| IUPAC Name | (2R,3S)-3-phenyl-2-propyl-1,3-oxaphospholan-5-one |
| SMILES | CCC[C@@H]1OC(=O)C[P@@]1c1ccccc1 |
| InChI | InChI=1S/C12H15O2P/c1-2-6-12-14-11(13)9-15(12)10-7-4-3-5-8-10/h3-5,7-8,12H,2,6,9H2,1H3/t12-,15+/m1/s1 |
| InChIKey | GYCHGJCLVWUDOV-DOMZBBRYSA-N |
| XLogP | 2.48 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 222.22 |
| LogP ≤ 5 | 2.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze (2R,3S)-3-phenyl-2-propyl-1,3-oxaphospholan-5-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2R,3S)-3-phenyl-2-propyl-1,3-oxaphospholan-5-one?
The IUPAC name of (2R,3S)-3-phenyl-2-propyl-1,3-oxaphospholan-5-one (CID 23280168) is (2R,3S)-3-phenyl-2-propyl-1,3-oxaphospholan-5-one.
What is the SMILES notation for (2R,3S)-3-phenyl-2-propyl-1,3-oxaphospholan-5-one?
The canonical SMILES for (2R,3S)-3-phenyl-2-propyl-1,3-oxaphospholan-5-one is CCC[C@@H]1OC(=O)C[P@@]1c1ccccc1.
What is the InChIKey of (2R,3S)-3-phenyl-2-propyl-1,3-oxaphospholan-5-one?
The InChIKey is GYCHGJCLVWUDOV-DOMZBBRYSA-N. The full InChI is InChI=1S/C12H15O2P/c1-2-6-12-14-11(13)9-15(12)10-7-4-3-5-8-10/h3-5,7-8,12H,2,6,9H2,1H3/t12-,15+/m1/s1.
What are the key properties of (2R,3S)-3-phenyl-2-propyl-1,3-oxaphospholan-5-one?
(2R,3S)-3-phenyl-2-propyl-1,3-oxaphospholan-5-one has a molecular weight of 222.22 g/mol, XLogP of 2.48, 3 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (2R,3S)-3-phenyl-2-propyl-1,3-oxaphospholan-5-one is sourced from PubChem (CID 23280168), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).