C9H17O2P — CID 23280299
3-methyl-1-(2-methylpropoxy)-2,5-dihydro-1λ5-phosphole 1-oxide (PubChem CID 23280299) has the molecular formula C9H17O2P and a molecular weight of 188.21 g/mol. Its IUPAC name is 3-methyl-1-(2-methylpropoxy)-2,5-dihydro-1λ5-phosphole 1-oxide.
| Compound Name | 3-methyl-1-(2-methylpropoxy)-2,5-dihydro-1λ5-phosphole 1-oxide |
|---|---|
| PubChem CID | 23280299 |
| Molecular Formula | C9H17O2P |
| Molecular Weight | 188.21 g/mol |
| Exact Mass | 188.10 |
| IUPAC Name | 3-methyl-1-(2-methylpropoxy)-2,5-dihydro-1λ5-phosphole 1-oxide |
| SMILES | CC1=CCP(=O)(OCC(C)C)C1 |
| InChI | InChI=1S/C9H17O2P/c1-8(2)6-11-12(10)5-4-9(3)7-12/h4,8H,5-7H2,1-3H3 |
| InChIKey | JDDUJFMRXDRYBA-UHFFFAOYSA-N |
| XLogP | 2.90 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 188.21 |
| LogP ≤ 5 | 2.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|