C10H20O6P2 — CID 23280390
2-[2-(1,3,2-dioxaphospholan-2-yloxy)ethoxy]-4,4,5,5-tetramethyl-1,3,2-dioxaphospholane (PubChem CID 23280390) has the molecular formula C10H20O6P2 and a molecular weight of 298.21 g/mol. Its IUPAC name is 2-[2-(1,3,2-dioxaphospholan-2-yloxy)ethoxy]-4,4,5,5-tetramethyl-1,3,2-dioxaphospholane.
| Compound Name | 2-[2-(1,3,2-dioxaphospholan-2-yloxy)ethoxy]-4,4,5,5-tetramethyl-1,3,2-dioxaphospholane |
|---|---|
| PubChem CID | 23280390 |
| Molecular Formula | C10H20O6P2 |
| Molecular Weight | 298.21 g/mol |
| Exact Mass | 298.07 |
| IUPAC Name | 2-[2-(1,3,2-dioxaphospholan-2-yloxy)ethoxy]-4,4,5,5-tetramethyl-1,3,2-dioxaphospholane |
| SMILES | CC1(C)OP(OCCOP2OCCO2)OC1(C)C |
| InChI | InChI=1S/C10H20O6P2/c1-9(2)10(3,4)16-18(15-9)14-8-7-13-17-11-5-6-12-17/h5-8H2,1-4H3 |
| InChIKey | AJBATDLHZVIARG-UHFFFAOYSA-N |
| XLogP | 3.12 |
| TPSA | 55.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.21 |
| LogP ≤ 5 | 3.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|