C20H24O5 — CID 23280880
(1R,3R,6S,7Z,10S,12R)-17-methoxy-3,10,12-trimethyl-16-oxatricyclo[12.2.1.01,6]heptadeca-4,7,14(17)-triene-9,13,15-trione (PubChem CID 23280880) has the molecular formula C20H24O5 and a molecular weight of 344.41 g/mol. Its IUPAC name is (1R,3R,6S,7Z,10S,12R)-17-methoxy-3,10,12-trimethyl-16-oxatricyclo[12.2.1.01,6]heptadeca-4,7,14(17)-triene-9,13,15-trione.
| Compound Name | (1R,3R,6S,7Z,10S,12R)-17-methoxy-3,10,12-trimethyl-16-oxatricyclo[12.2.1.01,6]heptadeca-4,7,14(17)-triene-9,13,15-trione |
|---|---|
| PubChem CID | 23280880 |
| Molecular Formula | C20H24O5 |
| Molecular Weight | 344.41 g/mol |
| Exact Mass | 344.16 |
| IUPAC Name | (1R,3R,6S,7Z,10S,12R)-17-methoxy-3,10,12-trimethyl-16-oxatricyclo[12.2.1.01,6]heptadeca-4,7,14(17)-triene-9,13,15-trione |
| SMILES | COC1=C2C(=O)O[C@@]13C[C@@H](C)C=C[C@H]3/C=C\C(=O)[C@@H](C)C[C@@H](C)C2=O |
| InChI | InChI=1S/C20H24O5/c1-11-5-6-14-7-8-15(21)12(2)9-13(3)17(22)16-18(24-4)20(14,10-11)25-19(16)23/h5-8,11-14H,9-10H2,1-4H3/b8-7-/t11-,12-,13+,14-,20+/m0/s1 |
| InChIKey | ANVVFZSODIYUDY-BSCKIEDASA-N |
| XLogP | 2.77 |
| TPSA | 69.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.41 |
| LogP ≤ 5 | 2.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|