C26H29NO4 — CID 23281323
(1R,2S,3R,6S,7R,8R,9R,13S)-3-tert-butyl-15-methoxy-6-methyl-11-phenyl-11-azapentacyclo[6.5.2.02,6.02,7.09,13]pentadec-14-ene-5,10,12-trione (PubChem CID 23281323) has the molecular formula C26H29NO4 and a molecular weight of 419.52 g/mol. Its IUPAC name is (1R,2S,3R,6S,7R,8R,9R,13S)-3-tert-butyl-15-methoxy-6-methyl-11-phenyl-11-azapentacyclo[6.5.2.02,6.02,7.09,13]pentadec-14-ene-5,10,12-trione.
| Compound Name | (1R,2S,3R,6S,7R,8R,9R,13S)-3-tert-butyl-15-methoxy-6-methyl-11-phenyl-11-azapentacyclo[6.5.2.02,6.02,7.09,13]pentadec-14-ene-5,10,12-trione |
|---|---|
| PubChem CID | 23281323 |
| Molecular Formula | C26H29NO4 |
| Molecular Weight | 419.52 g/mol |
| Exact Mass | 419.21 |
| IUPAC Name | (1R,2S,3R,6S,7R,8R,9R,13S)-3-tert-butyl-15-methoxy-6-methyl-11-phenyl-11-azapentacyclo[6.5.2.02,6.02,7.09,13]pentadec-14-ene-5,10,12-trione |
| SMILES | COC1=C[C@@H]2[C@@H]3C(=O)N(c4ccccc4)C(=O)[C@@H]3[C@H]1[C@@H]1[C@@]23[C@@H](C(C)(C)C)CC(=O)[C@@]13C |
| InChI | InChI=1S/C26H29NO4/c1-24(2,3)16-12-17(28)25(4)21-19-15(31-5)11-14(26(16,21)25)18-20(19)23(30)27(22(18)29)13-9-7-6-8-10-13/h6-11,14,16,18-21H,12H2,1-5H3/t14-,16-,18+,19+,20+,21+,25+,26+/m1/s1 |
| InChIKey | HSODNAWRCIXMDH-GFHJSYHDSA-N |
| XLogP | 3.84 |
| TPSA | 63.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.52 |
| LogP ≤ 5 | 3.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|