C15H15NO4 — CID 23281948
(3,5-dimethoxyphenyl) N-phenylcarbamate (PubChem CID 23281948) has the molecular formula C15H15NO4 and a molecular weight of 273.29 g/mol. Its IUPAC name is (3,5-dimethoxyphenyl) N-phenylcarbamate.
| Compound Name | (3,5-dimethoxyphenyl) N-phenylcarbamate |
|---|---|
| PubChem CID | 23281948 |
| Molecular Formula | C15H15NO4 |
| Molecular Weight | 273.29 g/mol |
| Exact Mass | 273.10 |
| IUPAC Name | (3,5-dimethoxyphenyl) N-phenylcarbamate |
| SMILES | COc1cc(OC)cc(OC(=O)Nc2ccccc2)c1 |
| InChI | InChI=1S/C15H15NO4/c1-18-12-8-13(19-2)10-14(9-12)20-15(17)16-11-6-4-3-5-7-11/h3-10H,1-2H3,(H,16,17) |
| InChIKey | JEOFHEXHEDYBSN-UHFFFAOYSA-N |
| XLogP | 3.31 |
| TPSA | 56.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 273.29 |
| LogP ≤ 5 | 3.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |