C18H24Si — CID 23282037
dimethyl-bis(2,4,5,6-tetrahydropentalen-2-yl)silane (PubChem CID 23282037) has the molecular formula C18H24Si and a molecular weight of 268.48 g/mol. Its IUPAC name is dimethyl-bis(2,4,5,6-tetrahydropentalen-2-yl)silane.
| Compound Name | dimethyl-bis(2,4,5,6-tetrahydropentalen-2-yl)silane |
|---|---|
| PubChem CID | 23282037 |
| Molecular Formula | C18H24Si |
| Molecular Weight | 268.48 g/mol |
| Exact Mass | 268.16 |
| IUPAC Name | dimethyl-bis(2,4,5,6-tetrahydropentalen-2-yl)silane |
| SMILES | C[Si](C)(C1C=C2CCCC2=C1)C1C=C2CCCC2=C1 |
| InChI | InChI=1S/C18H24Si/c1-19(2,17-9-13-5-3-6-14(13)10-17)18-11-15-7-4-8-16(15)12-18/h9-12,17-18H,3-8H2,1-2H3 |
| InChIKey | BKOULXTVYGMNMO-UHFFFAOYSA-N |
| XLogP | 5.54 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.48 |
| LogP ≤ 5 | 5.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|