About 2-azaspiro[4.6]undecane
2-azaspiro[4.6]undecane (PubChem CID 23282818) has the molecular formula C10H19N
and a molecular weight of 153.27 g/mol. Its IUPAC name is 2-azaspiro[4.6]undecane.
Molecular Properties
| Compound Name | 2-azaspiro[4.6]undecane |
| PubChem CID | 23282818 |
| Molecular Formula | C10H19N |
| Molecular Weight | 153.27 g/mol |
| Exact Mass | 153.15 |
| IUPAC Name | 2-azaspiro[4.6]undecane |
| SMILES | C1CCCC2(CC1)CCNC2 |
| InChI | InChI=1S/C10H19N/c1-2-4-6-10(5-3-1)7-8-11-9-10/h11H,1-9H2 |
| InChIKey | UYUUEEXDJGLCLY-UHFFFAOYSA-N |
| XLogP | 2.32 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 153.27 |
| LogP ≤ 5 | 2.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 2-azaspiro[4.6]undecane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-azaspiro[4.6]undecane?
The IUPAC name of 2-azaspiro[4.6]undecane (CID 23282818) is 2-azaspiro[4.6]undecane.
What is the SMILES notation for 2-azaspiro[4.6]undecane?
The canonical SMILES for 2-azaspiro[4.6]undecane is C1CCCC2(CC1)CCNC2.
What is the InChIKey of 2-azaspiro[4.6]undecane?
The InChIKey is UYUUEEXDJGLCLY-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H19N/c1-2-4-6-10(5-3-1)7-8-11-9-10/h11H,1-9H2.
What are the key properties of 2-azaspiro[4.6]undecane?
2-azaspiro[4.6]undecane has a molecular weight of 153.27 g/mol, XLogP of 2.32, 0 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 2-azaspiro[4.6]undecane is sourced from PubChem (CID 23282818), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).