C11H20N2O2 — CID 23282855
tert-butyl N-(1,2,3,6-tetrahydropyridin-4-ylmethyl)carbamate (PubChem CID 23282855) has the molecular formula C11H20N2O2 and a molecular weight of 212.29 g/mol. Its IUPAC name is tert-butyl N-(1,2,3,6-tetrahydropyridin-4-ylmethyl)carbamate.
| Compound Name | tert-butyl N-(1,2,3,6-tetrahydropyridin-4-ylmethyl)carbamate |
|---|---|
| PubChem CID | 23282855 |
| Molecular Formula | C11H20N2O2 |
| Molecular Weight | 212.29 g/mol |
| Exact Mass | 212.15 |
| IUPAC Name | tert-butyl N-(1,2,3,6-tetrahydropyridin-4-ylmethyl)carbamate |
| SMILES | CC(C)(C)OC(=O)NCC1=CCNCC1 |
| InChI | InChI=1S/C11H20N2O2/c1-11(2,3)15-10(14)13-8-9-4-6-12-7-5-9/h4,12H,5-8H2,1-3H3,(H,13,14) |
| InChIKey | BGEOHCNXIILQQR-UHFFFAOYSA-N |
| XLogP | 1.43 |
| TPSA | 50.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 212.29 |
| LogP ≤ 5 | 1.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|