About N-[dimethylamino-(1,3,5-trimethylpyrazol-4-yl)phosphinothioyl]-N-methylmethanamine
N-[dimethylamino-(1,3,5-trimethylpyrazol-4-yl)phosphinothioyl]-N-methylmethanamine (PubChem CID 2328305) has the molecular formula C10H21N4PS
and a molecular weight of 260.35 g/mol. Its IUPAC name is N-[dimethylamino-(1,3,5-trimethylpyrazol-4-yl)phosphinothioyl]-N-methylmethanamine.
Molecular Properties
| Compound Name | N-[dimethylamino-(1,3,5-trimethylpyrazol-4-yl)phosphinothioyl]-N-methylmethanamine |
| PubChem CID | 2328305 |
| Molecular Formula | C10H21N4PS |
| Molecular Weight | 260.35 g/mol |
| Exact Mass | 260.12 |
| IUPAC Name | N-[dimethylamino-(1,3,5-trimethylpyrazol-4-yl)phosphinothioyl]-N-methylmethanamine |
| SMILES | Cc1nn(C)c(C)c1P(=S)(N(C)C)N(C)C |
| InChI | InChI=1S/C10H21N4PS/c1-8-10(9(2)14(7)11-8)15(16,12(3)4)13(5)6/h1-7H3 |
| InChIKey | ORZOZUXGGVULBK-UHFFFAOYSA-N |
| XLogP | 1.09 |
| TPSA | 24.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 260.35 |
| LogP ≤ 5 | 1.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze N-[dimethylamino-(1,3,5-trimethylpyrazol-4-yl)phosphinothioyl]-N-methylmethanamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[dimethylamino-(1,3,5-trimethylpyrazol-4-yl)phosphinothioyl]-N-methylmethanamine?
The IUPAC name of N-[dimethylamino-(1,3,5-trimethylpyrazol-4-yl)phosphinothioyl]-N-methylmethanamine (CID 2328305) is N-[dimethylamino-(1,3,5-trimethylpyrazol-4-yl)phosphinothioyl]-N-methylmethanamine.
What is the SMILES notation for N-[dimethylamino-(1,3,5-trimethylpyrazol-4-yl)phosphinothioyl]-N-methylmethanamine?
The canonical SMILES for N-[dimethylamino-(1,3,5-trimethylpyrazol-4-yl)phosphinothioyl]-N-methylmethanamine is Cc1nn(C)c(C)c1P(=S)(N(C)C)N(C)C.
What is the InChIKey of N-[dimethylamino-(1,3,5-trimethylpyrazol-4-yl)phosphinothioyl]-N-methylmethanamine?
The InChIKey is ORZOZUXGGVULBK-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H21N4PS/c1-8-10(9(2)14(7)11-8)15(16,12(3)4)13(5)6/h1-7H3.
What are the key properties of N-[dimethylamino-(1,3,5-trimethylpyrazol-4-yl)phosphinothioyl]-N-methylmethanamine?
N-[dimethylamino-(1,3,5-trimethylpyrazol-4-yl)phosphinothioyl]-N-methylmethanamine has a molecular weight of 260.35 g/mol, XLogP of 1.09, 3 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N-[dimethylamino-(1,3,5-trimethylpyrazol-4-yl)phosphinothioyl]-N-methylmethanamine is sourced from PubChem (CID 2328305), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).