C37H46N3O3+ — CID 23283060
2-N-benzyl-9-N-[1-(cyclooctylmethyl)-1-methylpiperidin-1-ium-4-yl]-9H-xanthene-2,9-dicarboxamide (PubChem CID 23283060) has the molecular formula C37H46N3O3+ and a molecular weight of 580.79 g/mol. Its IUPAC name is 2-N-benzyl-9-N-[1-(cyclooctylmethyl)-1-methylpiperidin-1-ium-4-yl]-9H-xanthene-2,9-dicarboxamide.
| Compound Name | 2-N-benzyl-9-N-[1-(cyclooctylmethyl)-1-methylpiperidin-1-ium-4-yl]-9H-xanthene-2,9-dicarboxamide |
|---|---|
| PubChem CID | 23283060 |
| Molecular Formula | C37H46N3O3+ |
| Molecular Weight | 580.79 g/mol |
| Exact Mass | 580.35 |
| IUPAC Name | 2-N-benzyl-9-N-[1-(cyclooctylmethyl)-1-methylpiperidin-1-ium-4-yl]-9H-xanthene-2,9-dicarboxamide |
| SMILES | C[N+]1(CC2CCCCCCC2)CCC(NC(=O)C2c3ccccc3Oc3ccc(C(=O)NCc4ccccc4)cc32)CC1 |
| InChI | InChI=1S/C37H45N3O3/c1-40(26-28-14-6-3-2-4-7-15-28)22-20-30(21-23-40)39-37(42)35-31-16-10-11-17-33(31)43-34-19-18-29(24-32(34)35)36(41)38-25-27-12-8-5-9-13-27/h5,8-13,16-19,24,28,30,35H,2-4,6-7,14-15,20-23,25-26H2,1H3,(H-,38,39,41,42)/p+1 |
| InChIKey | KKOSDJOREJPMSC-UHFFFAOYSA-O |
| XLogP | 6.94 |
| TPSA | 67.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 580.79 |
| LogP ≤ 5 | 6.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|