About 1-butyl-2,3,3-trimethylindol-1-ium-5-sulfonate
1-butyl-2,3,3-trimethylindol-1-ium-5-sulfonate (PubChem CID 23283828) has the molecular formula C15H21NO3S
and a molecular weight of 295.40 g/mol. Its IUPAC name is 1-butyl-2,3,3-trimethylindol-1-ium-5-sulfonate.
Molecular Properties
| Compound Name | 1-butyl-2,3,3-trimethylindol-1-ium-5-sulfonate |
| PubChem CID | 23283828 |
| Molecular Formula | C15H21NO3S |
| Molecular Weight | 295.40 g/mol |
| Exact Mass | 295.12 |
| IUPAC Name | 1-butyl-2,3,3-trimethylindol-1-ium-5-sulfonate |
| SMILES | CCCC[N+]1=C(C)C(C)(C)c2cc(S(=O)(=O)[O-])ccc21 |
| InChI | InChI=1S/C15H21NO3S/c1-5-6-9-16-11(2)15(3,4)13-10-12(20(17,18)19)7-8-14(13)16/h7-8,10H,5-6,9H2,1-4H3 |
| InChIKey | DXADFBPLSJYMCF-UHFFFAOYSA-N |
| XLogP | 2.79 |
| TPSA | 60.21 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 295.40 |
| LogP ≤ 5 | 2.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|
Analyze 1-butyl-2,3,3-trimethylindol-1-ium-5-sulfonate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-butyl-2,3,3-trimethylindol-1-ium-5-sulfonate?
The IUPAC name of 1-butyl-2,3,3-trimethylindol-1-ium-5-sulfonate (CID 23283828) is 1-butyl-2,3,3-trimethylindol-1-ium-5-sulfonate.
What is the SMILES notation for 1-butyl-2,3,3-trimethylindol-1-ium-5-sulfonate?
The canonical SMILES for 1-butyl-2,3,3-trimethylindol-1-ium-5-sulfonate is CCCC[N+]1=C(C)C(C)(C)c2cc(S(=O)(=O)[O-])ccc21.
What is the InChIKey of 1-butyl-2,3,3-trimethylindol-1-ium-5-sulfonate?
The InChIKey is DXADFBPLSJYMCF-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H21NO3S/c1-5-6-9-16-11(2)15(3,4)13-10-12(20(17,18)19)7-8-14(13)16/h7-8,10H,5-6,9H2,1-4H3.
What are the key properties of 1-butyl-2,3,3-trimethylindol-1-ium-5-sulfonate?
1-butyl-2,3,3-trimethylindol-1-ium-5-sulfonate has a molecular weight of 295.40 g/mol, XLogP of 2.79, 4 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1-butyl-2,3,3-trimethylindol-1-ium-5-sulfonate is sourced from PubChem (CID 23283828), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).