About 4-(hydroxymethyl)-1,3-dihydroimidazole-2-thione
4-(hydroxymethyl)-1,3-dihydroimidazole-2-thione (PubChem CID 23283879) has the molecular formula C4H6N2OS
and a molecular weight of 130.17 g/mol. Its IUPAC name is 4-(hydroxymethyl)-1,3-dihydroimidazole-2-thione.
Molecular Properties
| Compound Name | 4-(hydroxymethyl)-1,3-dihydroimidazole-2-thione |
| PubChem CID | 23283879 |
| Molecular Formula | C4H6N2OS |
| Molecular Weight | 130.17 g/mol |
| Exact Mass | 130.02 |
| IUPAC Name | 4-(hydroxymethyl)-1,3-dihydroimidazole-2-thione |
| SMILES | OCc1c[nH]c(=S)[nH]1 |
| InChI | InChI=1S/C4H6N2OS/c7-2-3-1-5-4(8)6-3/h1,7H,2H2,(H2,5,6,8) |
| InChIKey | AJDIPXJCUNPHHS-UHFFFAOYSA-N |
| XLogP | 0.56 |
| TPSA | 51.81 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 8 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 130.17 |
| LogP ≤ 5 | 0.56 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|
Analyze 4-(hydroxymethyl)-1,3-dihydroimidazole-2-thione with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-(hydroxymethyl)-1,3-dihydroimidazole-2-thione?
The IUPAC name of 4-(hydroxymethyl)-1,3-dihydroimidazole-2-thione (CID 23283879) is 4-(hydroxymethyl)-1,3-dihydroimidazole-2-thione.
What is the SMILES notation for 4-(hydroxymethyl)-1,3-dihydroimidazole-2-thione?
The canonical SMILES for 4-(hydroxymethyl)-1,3-dihydroimidazole-2-thione is OCc1c[nH]c(=S)[nH]1.
What is the InChIKey of 4-(hydroxymethyl)-1,3-dihydroimidazole-2-thione?
The InChIKey is AJDIPXJCUNPHHS-UHFFFAOYSA-N. The full InChI is InChI=1S/C4H6N2OS/c7-2-3-1-5-4(8)6-3/h1,7H,2H2,(H2,5,6,8).
What are the key properties of 4-(hydroxymethyl)-1,3-dihydroimidazole-2-thione?
4-(hydroxymethyl)-1,3-dihydroimidazole-2-thione has a molecular weight of 130.17 g/mol, XLogP of 0.56, 1 rotatable bonds, 3 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(hydroxymethyl)-1,3-dihydroimidazole-2-thione is sourced from PubChem (CID 23283879), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).