About 6-methylidene-2H-1,3-benzothiazole
6-methylidene-2H-1,3-benzothiazole (PubChem CID 23283920) has the molecular formula C8H7NS
and a molecular weight of 149.22 g/mol. Its IUPAC name is 6-methylidene-2H-1,3-benzothiazole.
Molecular Properties
| Compound Name | 6-methylidene-2H-1,3-benzothiazole |
| PubChem CID | 23283920 |
| Molecular Formula | C8H7NS |
| Molecular Weight | 149.22 g/mol |
| Exact Mass | 149.03 |
| IUPAC Name | 6-methylidene-2H-1,3-benzothiazole |
| SMILES | C=c1ccc2c(c1)SCN=2 |
| InChI | InChI=1S/C8H7NS/c1-6-2-3-7-8(4-6)10-5-9-7/h2-4H,1,5H2 |
| InChIKey | RWGAUSTXKVRSBK-UHFFFAOYSA-N |
| XLogP | 0.78 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 149.22 |
| LogP ≤ 5 | 0.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 6-methylidene-2H-1,3-benzothiazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-methylidene-2H-1,3-benzothiazole?
The IUPAC name of 6-methylidene-2H-1,3-benzothiazole (CID 23283920) is 6-methylidene-2H-1,3-benzothiazole.
What is the SMILES notation for 6-methylidene-2H-1,3-benzothiazole?
The canonical SMILES for 6-methylidene-2H-1,3-benzothiazole is C=c1ccc2c(c1)SCN=2.
What is the InChIKey of 6-methylidene-2H-1,3-benzothiazole?
The InChIKey is RWGAUSTXKVRSBK-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H7NS/c1-6-2-3-7-8(4-6)10-5-9-7/h2-4H,1,5H2.
What are the key properties of 6-methylidene-2H-1,3-benzothiazole?
6-methylidene-2H-1,3-benzothiazole has a molecular weight of 149.22 g/mol, XLogP of 0.78, 0 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 6-methylidene-2H-1,3-benzothiazole is sourced from PubChem (CID 23283920), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).