C20H14F5N3O2S2 — CID 23285357
6-methyl-2-[1-(4-methylsulfonylphenyl)-3-(1,1,2,2,2-pentafluoroethyl)pyrazol-5-yl]-1,3-benzothiazole (PubChem CID 23285357) has the molecular formula C20H14F5N3O2S2 and a molecular weight of 487.48 g/mol. Its IUPAC name is 6-methyl-2-[1-(4-methylsulfonylphenyl)-3-(1,1,2,2,2-pentafluoroethyl)pyrazol-5-yl]-1,3-benzothiazole.
| Compound Name | 6-methyl-2-[1-(4-methylsulfonylphenyl)-3-(1,1,2,2,2-pentafluoroethyl)pyrazol-5-yl]-1,3-benzothiazole |
|---|---|
| PubChem CID | 23285357 |
| Molecular Formula | C20H14F5N3O2S2 |
| Molecular Weight | 487.48 g/mol |
| Exact Mass | 487.04 |
| IUPAC Name | 6-methyl-2-[1-(4-methylsulfonylphenyl)-3-(1,1,2,2,2-pentafluoroethyl)pyrazol-5-yl]-1,3-benzothiazole |
| SMILES | Cc1ccc2nc(-c3cc(C(F)(F)C(F)(F)F)nn3-c3ccc(S(C)(=O)=O)cc3)sc2c1 |
| InChI | InChI=1S/C20H14F5N3O2S2/c1-11-3-8-14-16(9-11)31-18(26-14)15-10-17(19(21,22)20(23,24)25)27-28(15)12-4-6-13(7-5-12)32(2,29)30/h3-10H,1-2H3 |
| InChIKey | JIVDKIRYXZDQBE-UHFFFAOYSA-N |
| XLogP | 5.52 |
| TPSA | 64.85 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 487.48 |
| LogP ≤ 5 | 5.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|