C19H13F5N4O2S2 — CID 23285415
4-[5-(6-methyl-1,3-benzothiazol-2-yl)-3-(1,1,2,2,2-pentafluoroethyl)pyrazol-1-yl]benzenesulfonamide (PubChem CID 23285415) has the molecular formula C19H13F5N4O2S2 and a molecular weight of 488.46 g/mol. Its IUPAC name is 4-[5-(6-methyl-1,3-benzothiazol-2-yl)-3-(1,1,2,2,2-pentafluoroethyl)pyrazol-1-yl]benzenesulfonamide.
| Compound Name | 4-[5-(6-methyl-1,3-benzothiazol-2-yl)-3-(1,1,2,2,2-pentafluoroethyl)pyrazol-1-yl]benzenesulfonamide |
|---|---|
| PubChem CID | 23285415 |
| Molecular Formula | C19H13F5N4O2S2 |
| Molecular Weight | 488.46 g/mol |
| Exact Mass | 488.04 |
| IUPAC Name | 4-[5-(6-methyl-1,3-benzothiazol-2-yl)-3-(1,1,2,2,2-pentafluoroethyl)pyrazol-1-yl]benzenesulfonamide |
| SMILES | Cc1ccc2nc(-c3cc(C(F)(F)C(F)(F)F)nn3-c3ccc(S(N)(=O)=O)cc3)sc2c1 |
| InChI | InChI=1S/C19H13F5N4O2S2/c1-10-2-7-13-15(8-10)31-17(26-13)14-9-16(18(20,21)19(22,23)24)27-28(14)11-3-5-12(6-4-11)32(25,29)30/h2-9H,1H3,(H2,25,29,30) |
| InChIKey | RRYZPJRDWJLTLL-UHFFFAOYSA-N |
| XLogP | 4.76 |
| TPSA | 90.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 488.46 |
| LogP ≤ 5 | 4.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|