About [2-[(6-chloro-1,3-benzodioxol-5-yl)methyl]-3-methoxy-3-oxopropyl]-trimethylazanium iodide
[2-[(6-chloro-1,3-benzodioxol-5-yl)methyl]-3-methoxy-3-oxopropyl]-trimethylazanium iodide (PubChem CID 23285598) has the molecular formula C15H21ClINO4
and a molecular weight of 441.69 g/mol. Its IUPAC name is [2-[(6-chloro-1,3-benzodioxol-5-yl)methyl]-3-methoxy-3-oxopropyl]-trimethylazanium iodide.
Molecular Properties
| Compound Name | [2-[(6-chloro-1,3-benzodioxol-5-yl)methyl]-3-methoxy-3-oxopropyl]-trimethylazanium iodide |
| PubChem CID | 23285598 |
| Molecular Formula | C15H21ClINO4 |
| Molecular Weight | 441.69 g/mol |
| Exact Mass | 441.02 |
| IUPAC Name | [2-[(6-chloro-1,3-benzodioxol-5-yl)methyl]-3-methoxy-3-oxopropyl]-trimethylazanium iodide |
| SMILES | COC(=O)C(Cc1cc2c(cc1Cl)OCO2)C[N+](C)(C)C.[I-] |
| InChI | InChI=1S/C15H21ClNO4.HI/c1-17(2,3)8-11(15(18)19-4)5-10-6-13-14(7-12(10)16)21-9-20-13;/h6-7,11H,5,8-9H2,1-4H3;1H/q+1;/p-1 |
| InChIKey | QCTJWEOUCWOYJG-UHFFFAOYSA-M |
| XLogP | -0.89 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 441.69 |
| LogP ≤ 5 | -0.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|
Analyze [2-[(6-chloro-1,3-benzodioxol-5-yl)methyl]-3-methoxy-3-oxopropyl]-trimethylazanium iodide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [2-[(6-chloro-1,3-benzodioxol-5-yl)methyl]-3-methoxy-3-oxopropyl]-trimethylazanium iodide?
The IUPAC name of [2-[(6-chloro-1,3-benzodioxol-5-yl)methyl]-3-methoxy-3-oxopropyl]-trimethylazanium iodide (CID 23285598) is [2-[(6-chloro-1,3-benzodioxol-5-yl)methyl]-3-methoxy-3-oxopropyl]-trimethylazanium iodide.
What is the SMILES notation for [2-[(6-chloro-1,3-benzodioxol-5-yl)methyl]-3-methoxy-3-oxopropyl]-trimethylazanium iodide?
The canonical SMILES for [2-[(6-chloro-1,3-benzodioxol-5-yl)methyl]-3-methoxy-3-oxopropyl]-trimethylazanium iodide is COC(=O)C(Cc1cc2c(cc1Cl)OCO2)C[N+](C)(C)C.[I-].
What is the InChIKey of [2-[(6-chloro-1,3-benzodioxol-5-yl)methyl]-3-methoxy-3-oxopropyl]-trimethylazanium iodide?
The InChIKey is QCTJWEOUCWOYJG-UHFFFAOYSA-M. The full InChI is InChI=1S/C15H21ClNO4.HI/c1-17(2,3)8-11(15(18)19-4)5-10-6-13-14(7-12(10)16)21-9-20-13;/h6-7,11H,5,8-9H2,1-4H3;1H/q+1;/p-1.
What are the key properties of [2-[(6-chloro-1,3-benzodioxol-5-yl)methyl]-3-methoxy-3-oxopropyl]-trimethylazanium iodide?
[2-[(6-chloro-1,3-benzodioxol-5-yl)methyl]-3-methoxy-3-oxopropyl]-trimethylazanium iodide has a molecular weight of 441.69 g/mol, XLogP of -0.89, 5 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for [2-[(6-chloro-1,3-benzodioxol-5-yl)methyl]-3-methoxy-3-oxopropyl]-trimethylazanium iodide is sourced from PubChem (CID 23285598), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).