About 3-[6-[1-[5-(4-chlorobenzoyl)-4-methyl-1H-pyrrol-2-yl]ethyl]-3-pyridinyl]-1,1-dimethylurea
3-[6-[1-[5-(4-chlorobenzoyl)-4-methyl-1H-pyrrol-2-yl]ethyl]-3-pyridinyl]-1,1-dimethylurea (PubChem CID 23285659) has the molecular formula C22H23ClN4O2
and a molecular weight of 410.91 g/mol. Its IUPAC name is 3-[6-[1-[5-(4-chlorobenzoyl)-4-methyl-1H-pyrrol-2-yl]ethyl]-3-pyridinyl]-1,1-dimethylurea.
Molecular Properties
| Compound Name | 3-[6-[1-[5-(4-chlorobenzoyl)-4-methyl-1H-pyrrol-2-yl]ethyl]-3-pyridinyl]-1,1-dimethylurea |
| PubChem CID | 23285659 |
| Molecular Formula | C22H23ClN4O2 |
| Molecular Weight | 410.91 g/mol |
| Exact Mass | 410.15 |
| IUPAC Name | 3-[6-[1-[5-(4-chlorobenzoyl)-4-methyl-1H-pyrrol-2-yl]ethyl]-3-pyridinyl]-1,1-dimethylurea |
| SMILES | Cc1cc(C(C)c2ccc(NC(=O)N(C)C)cn2)[nH]c1C(=O)c1ccc(Cl)cc1 |
| InChI | InChI=1S/C22H23ClN4O2/c1-13-11-19(26-20(13)21(28)15-5-7-16(23)8-6-15)14(2)18-10-9-17(12-24-18)25-22(29)27(3)4/h5-12,14,26H,1-4H3,(H,25,29) |
| InChIKey | ODYKRXHLHCNQEO-UHFFFAOYSA-N |
| XLogP | 4.85 |
| TPSA | 78.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 410.91 |
| LogP ≤ 5 | 4.85 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 3-[6-[1-[5-(4-chlorobenzoyl)-4-methyl-1H-pyrrol-2-yl]ethyl]-3-pyridinyl]-1,1-dimethylurea with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-[6-[1-[5-(4-chlorobenzoyl)-4-methyl-1H-pyrrol-2-yl]ethyl]-3-pyridinyl]-1,1-dimethylurea?
The IUPAC name of 3-[6-[1-[5-(4-chlorobenzoyl)-4-methyl-1H-pyrrol-2-yl]ethyl]-3-pyridinyl]-1,1-dimethylurea (CID 23285659) is 3-[6-[1-[5-(4-chlorobenzoyl)-4-methyl-1H-pyrrol-2-yl]ethyl]-3-pyridinyl]-1,1-dimethylurea.
What is the SMILES notation for 3-[6-[1-[5-(4-chlorobenzoyl)-4-methyl-1H-pyrrol-2-yl]ethyl]-3-pyridinyl]-1,1-dimethylurea?
The canonical SMILES for 3-[6-[1-[5-(4-chlorobenzoyl)-4-methyl-1H-pyrrol-2-yl]ethyl]-3-pyridinyl]-1,1-dimethylurea is Cc1cc(C(C)c2ccc(NC(=O)N(C)C)cn2)[nH]c1C(=O)c1ccc(Cl)cc1.
What is the InChIKey of 3-[6-[1-[5-(4-chlorobenzoyl)-4-methyl-1H-pyrrol-2-yl]ethyl]-3-pyridinyl]-1,1-dimethylurea?
The InChIKey is ODYKRXHLHCNQEO-UHFFFAOYSA-N. The full InChI is InChI=1S/C22H23ClN4O2/c1-13-11-19(26-20(13)21(28)15-5-7-16(23)8-6-15)14(2)18-10-9-17(12-24-18)25-22(29)27(3)4/h5-12,14,26H,1-4H3,(H,25,29).
What are the key properties of 3-[6-[1-[5-(4-chlorobenzoyl)-4-methyl-1H-pyrrol-2-yl]ethyl]-3-pyridinyl]-1,1-dimethylurea?
3-[6-[1-[5-(4-chlorobenzoyl)-4-methyl-1H-pyrrol-2-yl]ethyl]-3-pyridinyl]-1,1-dimethylurea has a molecular weight of 410.91 g/mol, XLogP of 4.85, 5 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[6-[1-[5-(4-chlorobenzoyl)-4-methyl-1H-pyrrol-2-yl]ethyl]-3-pyridinyl]-1,1-dimethylurea is sourced from PubChem (CID 23285659), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).