C26H38O4 — CID 23286172
2-(cyclopentylmethoxymethyl)-9-formyl-5-methyl-13-propan-2-yltetracyclo[7.4.0.02,11.04,8]tridec-12-ene-1-carboxylic acid (PubChem CID 23286172) has the molecular formula C26H38O4 and a molecular weight of 414.59 g/mol. Its IUPAC name is 2-(cyclopentylmethoxymethyl)-9-formyl-5-methyl-13-propan-2-yltetracyclo[7.4.0.02,11.04,8]tridec-12-ene-1-carboxylic acid.
| Compound Name | 2-(cyclopentylmethoxymethyl)-9-formyl-5-methyl-13-propan-2-yltetracyclo[7.4.0.02,11.04,8]tridec-12-ene-1-carboxylic acid |
|---|---|
| PubChem CID | 23286172 |
| Molecular Formula | C26H38O4 |
| Molecular Weight | 414.59 g/mol |
| Exact Mass | 414.28 |
| IUPAC Name | 2-(cyclopentylmethoxymethyl)-9-formyl-5-methyl-13-propan-2-yltetracyclo[7.4.0.02,11.04,8]tridec-12-ene-1-carboxylic acid |
| SMILES | CC(C)C1=CC2CC3(C=O)C4CCC(C)C4CC2(COCC2CCCC2)C13C(=O)O |
| InChI | InChI=1S/C26H38O4/c1-16(2)22-10-19-11-24(14-27)21-9-8-17(3)20(21)12-25(19,26(22,24)23(28)29)15-30-13-18-6-4-5-7-18/h10,14,16-21H,4-9,11-13,15H2,1-3H3,(H,28,29) |
| InChIKey | JPNUMULAHQSUOC-UHFFFAOYSA-N |
| XLogP | 5.12 |
| TPSA | 63.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.59 |
| LogP ≤ 5 | 5.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|