C4H14N2O6S2 — CID 23286412
ethane-1,2-diol;ethane-1,2-disulfonamide (PubChem CID 23286412) has the molecular formula C4H14N2O6S2 and a molecular weight of 250.30 g/mol. Its IUPAC name is ethane-1,2-diol;ethane-1,2-disulfonamide.
| Compound Name | ethane-1,2-diol;ethane-1,2-disulfonamide |
|---|---|
| PubChem CID | 23286412 |
| Molecular Formula | C4H14N2O6S2 |
| Molecular Weight | 250.30 g/mol |
| Exact Mass | 250.03 |
| IUPAC Name | ethane-1,2-diol;ethane-1,2-disulfonamide |
| SMILES | NS(=O)(=O)CCS(N)(=O)=O.OCCO |
| InChI | InChI=1S/C2H8N2O4S2.C2H6O2/c3-9(5,6)1-2-10(4,7)8;3-1-2-4/h1-2H2,(H2,3,5,6)(H2,4,7,8);3-4H,1-2H2 |
| InChIKey | KOLNWMBSVMRMPT-UHFFFAOYSA-N |
| XLogP | -3.47 |
| TPSA | 160.78 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 250.30 |
| LogP ≤ 5 | -3.47 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |