C24H46O2 — CID 23286510
4,5-dimethyl-2-(6,10,14-trimethylpentadec-1-en-2-yl)-1,3-dioxane (PubChem CID 23286510) has the molecular formula C24H46O2 and a molecular weight of 366.63 g/mol. Its IUPAC name is 4,5-dimethyl-2-(6,10,14-trimethylpentadec-1-en-2-yl)-1,3-dioxane.
| Compound Name | 4,5-dimethyl-2-(6,10,14-trimethylpentadec-1-en-2-yl)-1,3-dioxane |
|---|---|
| PubChem CID | 23286510 |
| Molecular Formula | C24H46O2 |
| Molecular Weight | 366.63 g/mol |
| Exact Mass | 366.35 |
| IUPAC Name | 4,5-dimethyl-2-(6,10,14-trimethylpentadec-1-en-2-yl)-1,3-dioxane |
| SMILES | C=C(CCCC(C)CCCC(C)CCCC(C)C)C1OCC(C)C(C)O1 |
| InChI | InChI=1S/C24H46O2/c1-18(2)11-8-12-19(3)13-9-14-20(4)15-10-16-21(5)24-25-17-22(6)23(7)26-24/h18-20,22-24H,5,8-17H2,1-4,6-7H3 |
| InChIKey | VLWSJWGRVFGWLC-UHFFFAOYSA-N |
| XLogP | 7.38 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.63 |
| LogP ≤ 5 | 7.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|