C23H48Si3 — CID 23286652
[2,3-bis[tert-butyl(dimethyl)silyl]cyclopenta-1,3-dien-1-yl]-tert-butyl-dimethylsilane (PubChem CID 23286652) has the molecular formula C23H48Si3 and a molecular weight of 408.90 g/mol. Its IUPAC name is [2,3-bis[tert-butyl(dimethyl)silyl]cyclopenta-1,3-dien-1-yl]-tert-butyl-dimethylsilane.
| Compound Name | [2,3-bis[tert-butyl(dimethyl)silyl]cyclopenta-1,3-dien-1-yl]-tert-butyl-dimethylsilane |
|---|---|
| PubChem CID | 23286652 |
| Molecular Formula | C23H48Si3 |
| Molecular Weight | 408.90 g/mol |
| Exact Mass | 408.31 |
| IUPAC Name | [2,3-bis[tert-butyl(dimethyl)silyl]cyclopenta-1,3-dien-1-yl]-tert-butyl-dimethylsilane |
| SMILES | CC(C)(C)[Si](C)(C)C1=CCC([Si](C)(C)C(C)(C)C)=C1[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C23H48Si3/c1-21(2,3)24(10,11)18-16-17-19(25(12,13)22(4,5)6)20(18)26(14,15)23(7,8)9/h16H,17H2,1-15H3 |
| InChIKey | SBWJAUNXPISONL-UHFFFAOYSA-N |
| XLogP | 8.76 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.90 |
| LogP ≤ 5 | 8.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|