About 2-[[4-(2,5-diaminophenyl)thiophen-3-yl]methylamino]-6-methylbenzenethiol;dihydrochloride
2-[[4-(2,5-diaminophenyl)thiophen-3-yl]methylamino]-6-methylbenzenethiol;dihydrochloride (PubChem CID 23286909) has the molecular formula C18H21Cl2N3S2
and a molecular weight of 414.43 g/mol. Its IUPAC name is 2-[[4-(2,5-diaminophenyl)thiophen-3-yl]methylamino]-6-methylbenzenethiol;dihydrochloride.
Molecular Properties
| Compound Name | 2-[[4-(2,5-diaminophenyl)thiophen-3-yl]methylamino]-6-methylbenzenethiol;dihydrochloride |
| PubChem CID | 23286909 |
| Molecular Formula | C18H21Cl2N3S2 |
| Molecular Weight | 414.43 g/mol |
| Exact Mass | 413.06 |
| IUPAC Name | 2-[[4-(2,5-diaminophenyl)thiophen-3-yl]methylamino]-6-methylbenzenethiol;dihydrochloride |
| SMILES | Cc1cccc(NCc2cscc2-c2cc(N)ccc2N)c1S.Cl.Cl |
| InChI | InChI=1S/C18H19N3S2.2ClH/c1-11-3-2-4-17(18(11)22)21-8-12-9-23-10-15(12)14-7-13(19)5-6-16(14)20;;/h2-7,9-10,21-22H,8,19-20H2,1H3;2*1H |
| InChIKey | PZSAEZLZPPQFIR-UHFFFAOYSA-N |
| XLogP | 5.63 |
| TPSA | 64.07 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 414.43 |
| LogP ≤ 5 | 5.63 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|
Analyze 2-[[4-(2,5-diaminophenyl)thiophen-3-yl]methylamino]-6-methylbenzenethiol;dihydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[[4-(2,5-diaminophenyl)thiophen-3-yl]methylamino]-6-methylbenzenethiol;dihydrochloride?
The IUPAC name of 2-[[4-(2,5-diaminophenyl)thiophen-3-yl]methylamino]-6-methylbenzenethiol;dihydrochloride (CID 23286909) is 2-[[4-(2,5-diaminophenyl)thiophen-3-yl]methylamino]-6-methylbenzenethiol;dihydrochloride.
What is the SMILES notation for 2-[[4-(2,5-diaminophenyl)thiophen-3-yl]methylamino]-6-methylbenzenethiol;dihydrochloride?
The canonical SMILES for 2-[[4-(2,5-diaminophenyl)thiophen-3-yl]methylamino]-6-methylbenzenethiol;dihydrochloride is Cc1cccc(NCc2cscc2-c2cc(N)ccc2N)c1S.Cl.Cl.
What is the InChIKey of 2-[[4-(2,5-diaminophenyl)thiophen-3-yl]methylamino]-6-methylbenzenethiol;dihydrochloride?
The InChIKey is PZSAEZLZPPQFIR-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H19N3S2.2ClH/c1-11-3-2-4-17(18(11)22)21-8-12-9-23-10-15(12)14-7-13(19)5-6-16(14)20;;/h2-7,9-10,21-22H,8,19-20H2,1H3;2*1H.
What are the key properties of 2-[[4-(2,5-diaminophenyl)thiophen-3-yl]methylamino]-6-methylbenzenethiol;dihydrochloride?
2-[[4-(2,5-diaminophenyl)thiophen-3-yl]methylamino]-6-methylbenzenethiol;dihydrochloride has a molecular weight of 414.43 g/mol, XLogP of 5.63, 4 rotatable bonds, 4 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[[4-(2,5-diaminophenyl)thiophen-3-yl]methylamino]-6-methylbenzenethiol;dihydrochloride is sourced from PubChem (CID 23286909), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).