C18H15F6NO4 — CID 2328696
N-[3,5-bis(2,2,2-trifluoroethoxy)phenyl]-4-methoxybenzamide (PubChem CID 2328696) has the molecular formula C18H15F6NO4 and a molecular weight of 423.31 g/mol. Its IUPAC name is N-[3,5-bis(2,2,2-trifluoroethoxy)phenyl]-4-methoxybenzamide.
| Compound Name | N-[3,5-bis(2,2,2-trifluoroethoxy)phenyl]-4-methoxybenzamide |
|---|---|
| PubChem CID | 2328696 |
| Molecular Formula | C18H15F6NO4 |
| Molecular Weight | 423.31 g/mol |
| Exact Mass | 423.09 |
| IUPAC Name | N-[3,5-bis(2,2,2-trifluoroethoxy)phenyl]-4-methoxybenzamide |
| SMILES | COc1ccc(C(=O)Nc2cc(OCC(F)(F)F)cc(OCC(F)(F)F)c2)cc1 |
| InChI | InChI=1S/C18H15F6NO4/c1-27-13-4-2-11(3-5-13)16(26)25-12-6-14(28-9-17(19,20)21)8-15(7-12)29-10-18(22,23)24/h2-8H,9-10H2,1H3,(H,25,26) |
| InChIKey | OUGXWYSNLOGZED-UHFFFAOYSA-N |
| XLogP | 4.83 |
| TPSA | 56.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.31 |
| LogP ≤ 5 | 4.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |