About N-ethyl-2-methylprop-2-enamide;N-propylprop-2-enamide
N-ethyl-2-methylprop-2-enamide;N-propylprop-2-enamide (PubChem CID 23287262) has the molecular formula C12H22N2O2
and a molecular weight of 226.32 g/mol. Its IUPAC name is N-ethyl-2-methylprop-2-enamide;N-propylprop-2-enamide.
Molecular Properties
| Compound Name | N-ethyl-2-methylprop-2-enamide;N-propylprop-2-enamide |
| PubChem CID | 23287262 |
| Molecular Formula | C12H22N2O2 |
| Molecular Weight | 226.32 g/mol |
| Exact Mass | 226.17 |
| IUPAC Name | N-ethyl-2-methylprop-2-enamide;N-propylprop-2-enamide |
| SMILES | C=C(C)C(=O)NCC.C=CC(=O)NCCC |
| InChI | InChI=1S/2C6H11NO/c1-4-7-6(8)5(2)3;1-3-5-7-6(8)4-2/h2,4H2,1,3H3,(H,7,8);4H,2-3,5H2,1H3,(H,7,8) |
| InChIKey | IZASUORXRXLHKA-UHFFFAOYSA-N |
| XLogP | 1.40 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 226.32 |
| LogP ≤ 5 | 1.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze N-ethyl-2-methylprop-2-enamide;N-propylprop-2-enamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-ethyl-2-methylprop-2-enamide;N-propylprop-2-enamide?
The IUPAC name of N-ethyl-2-methylprop-2-enamide;N-propylprop-2-enamide (CID 23287262) is N-ethyl-2-methylprop-2-enamide;N-propylprop-2-enamide.
What is the SMILES notation for N-ethyl-2-methylprop-2-enamide;N-propylprop-2-enamide?
The canonical SMILES for N-ethyl-2-methylprop-2-enamide;N-propylprop-2-enamide is C=C(C)C(=O)NCC.C=CC(=O)NCCC.
What is the InChIKey of N-ethyl-2-methylprop-2-enamide;N-propylprop-2-enamide?
The InChIKey is IZASUORXRXLHKA-UHFFFAOYSA-N. The full InChI is InChI=1S/2C6H11NO/c1-4-7-6(8)5(2)3;1-3-5-7-6(8)4-2/h2,4H2,1,3H3,(H,7,8);4H,2-3,5H2,1H3,(H,7,8).
What are the key properties of N-ethyl-2-methylprop-2-enamide;N-propylprop-2-enamide?
N-ethyl-2-methylprop-2-enamide;N-propylprop-2-enamide has a molecular weight of 226.32 g/mol, XLogP of 1.40, 5 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for N-ethyl-2-methylprop-2-enamide;N-propylprop-2-enamide is sourced from PubChem (CID 23287262), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).