About 2-[[4-(diethylsulfamoyl)benzoyl]amino]ethyl 2,4-difluorobenzoate
2-[[4-(diethylsulfamoyl)benzoyl]amino]ethyl 2,4-difluorobenzoate (PubChem CID 2328727) has the molecular formula C20H22F2N2O5S
and a molecular weight of 440.47 g/mol. Its IUPAC name is 2-[[4-(diethylsulfamoyl)benzoyl]amino]ethyl 2,4-difluorobenzoate.
Molecular Properties
| Compound Name | 2-[[4-(diethylsulfamoyl)benzoyl]amino]ethyl 2,4-difluorobenzoate |
| PubChem CID | 2328727 |
| Molecular Formula | C20H22F2N2O5S |
| Molecular Weight | 440.47 g/mol |
| Exact Mass | 440.12 |
| IUPAC Name | 2-[[4-(diethylsulfamoyl)benzoyl]amino]ethyl 2,4-difluorobenzoate |
| SMILES | CCN(CC)S(=O)(=O)c1ccc(C(=O)NCCOC(=O)c2ccc(F)cc2F)cc1 |
| InChI | InChI=1S/C20H22F2N2O5S/c1-3-24(4-2)30(27,28)16-8-5-14(6-9-16)19(25)23-11-12-29-20(26)17-10-7-15(21)13-18(17)22/h5-10,13H,3-4,11-12H2,1-2H3,(H,23,25) |
| InChIKey | FKDQMRUUDGBLHP-UHFFFAOYSA-N |
| XLogP | 2.58 |
| TPSA | 92.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 440.47 |
| LogP ≤ 5 | 2.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 2-[[4-(diethylsulfamoyl)benzoyl]amino]ethyl 2,4-difluorobenzoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[[4-(diethylsulfamoyl)benzoyl]amino]ethyl 2,4-difluorobenzoate?
The IUPAC name of 2-[[4-(diethylsulfamoyl)benzoyl]amino]ethyl 2,4-difluorobenzoate (CID 2328727) is 2-[[4-(diethylsulfamoyl)benzoyl]amino]ethyl 2,4-difluorobenzoate.
What is the SMILES notation for 2-[[4-(diethylsulfamoyl)benzoyl]amino]ethyl 2,4-difluorobenzoate?
The canonical SMILES for 2-[[4-(diethylsulfamoyl)benzoyl]amino]ethyl 2,4-difluorobenzoate is CCN(CC)S(=O)(=O)c1ccc(C(=O)NCCOC(=O)c2ccc(F)cc2F)cc1.
What is the InChIKey of 2-[[4-(diethylsulfamoyl)benzoyl]amino]ethyl 2,4-difluorobenzoate?
The InChIKey is FKDQMRUUDGBLHP-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H22F2N2O5S/c1-3-24(4-2)30(27,28)16-8-5-14(6-9-16)19(25)23-11-12-29-20(26)17-10-7-15(21)13-18(17)22/h5-10,13H,3-4,11-12H2,1-2H3,(H,23,25).
What are the key properties of 2-[[4-(diethylsulfamoyl)benzoyl]amino]ethyl 2,4-difluorobenzoate?
2-[[4-(diethylsulfamoyl)benzoyl]amino]ethyl 2,4-difluorobenzoate has a molecular weight of 440.47 g/mol, XLogP of 2.58, 9 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[[4-(diethylsulfamoyl)benzoyl]amino]ethyl 2,4-difluorobenzoate is sourced from PubChem (CID 2328727), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).