About 1-ethenyl-2-undecyl-4,5-dihydroimidazole
1-ethenyl-2-undecyl-4,5-dihydroimidazole (PubChem CID 23287321) has the molecular formula C16H30N2
and a molecular weight of 250.43 g/mol. Its IUPAC name is 1-ethenyl-2-undecyl-4,5-dihydroimidazole.
Molecular Properties
| Compound Name | 1-ethenyl-2-undecyl-4,5-dihydroimidazole |
| PubChem CID | 23287321 |
| Molecular Formula | C16H30N2 |
| Molecular Weight | 250.43 g/mol |
| Exact Mass | 250.24 |
| IUPAC Name | 1-ethenyl-2-undecyl-4,5-dihydroimidazole |
| SMILES | C=CN1CCN=C1CCCCCCCCCCC |
| InChI | InChI=1S/C16H30N2/c1-3-5-6-7-8-9-10-11-12-13-16-17-14-15-18(16)4-2/h4H,2-3,5-15H2,1H3 |
| InChIKey | ZBUHHBYWBKBQSW-UHFFFAOYSA-N |
| XLogP | 4.76 |
| TPSA | 15.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 250.43 |
| LogP ≤ 5 | 4.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 1-ethenyl-2-undecyl-4,5-dihydroimidazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-ethenyl-2-undecyl-4,5-dihydroimidazole?
The IUPAC name of 1-ethenyl-2-undecyl-4,5-dihydroimidazole (CID 23287321) is 1-ethenyl-2-undecyl-4,5-dihydroimidazole.
What is the SMILES notation for 1-ethenyl-2-undecyl-4,5-dihydroimidazole?
The canonical SMILES for 1-ethenyl-2-undecyl-4,5-dihydroimidazole is C=CN1CCN=C1CCCCCCCCCCC.
What is the InChIKey of 1-ethenyl-2-undecyl-4,5-dihydroimidazole?
The InChIKey is ZBUHHBYWBKBQSW-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H30N2/c1-3-5-6-7-8-9-10-11-12-13-16-17-14-15-18(16)4-2/h4H,2-3,5-15H2,1H3.
What are the key properties of 1-ethenyl-2-undecyl-4,5-dihydroimidazole?
1-ethenyl-2-undecyl-4,5-dihydroimidazole has a molecular weight of 250.43 g/mol, XLogP of 4.76, 11 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1-ethenyl-2-undecyl-4,5-dihydroimidazole is sourced from PubChem (CID 23287321), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).