C14H15N3OS — CID 23287602
2-(2-bicyclo[2.2.1]heptanylamino)pyrido[3,2-e][1,3]thiazin-4-one (PubChem CID 23287602) has the molecular formula C14H15N3OS and a molecular weight of 273.36 g/mol. Its IUPAC name is 2-(2-bicyclo[2.2.1]heptanylamino)pyrido[3,2-e][1,3]thiazin-4-one.
| Compound Name | 2-(2-bicyclo[2.2.1]heptanylamino)pyrido[3,2-e][1,3]thiazin-4-one |
|---|---|
| PubChem CID | 23287602 |
| Molecular Formula | C14H15N3OS |
| Molecular Weight | 273.36 g/mol |
| Exact Mass | 273.09 |
| IUPAC Name | 2-(2-bicyclo[2.2.1]heptanylamino)pyrido[3,2-e][1,3]thiazin-4-one |
| SMILES | O=c1nc(NC2CC3CCC2C3)sc2ncccc12 |
| InChI | InChI=1S/C14H15N3OS/c18-12-10-2-1-5-15-13(10)19-14(17-12)16-11-7-8-3-4-9(11)6-8/h1-2,5,8-9,11H,3-4,6-7H2,(H,16,17,18) |
| InChIKey | PJDDZQGFBYZNNV-UHFFFAOYSA-N |
| XLogP | 2.65 |
| TPSA | 54.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 273.36 |
| LogP ≤ 5 | 2.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |