C14H17ClN2O2 — CID 23287790
6-hydroxy-5-(pyrrolidin-1-ylmethyl)-1H-quinolin-2-one;hydrochloride (PubChem CID 23287790) has the molecular formula C14H17ClN2O2 and a molecular weight of 280.75 g/mol. Its IUPAC name is 6-hydroxy-5-(pyrrolidin-1-ylmethyl)-1H-quinolin-2-one;hydrochloride.
| Compound Name | 6-hydroxy-5-(pyrrolidin-1-ylmethyl)-1H-quinolin-2-one;hydrochloride |
|---|---|
| PubChem CID | 23287790 |
| Molecular Formula | C14H17ClN2O2 |
| Molecular Weight | 280.75 g/mol |
| Exact Mass | 280.10 |
| IUPAC Name | 6-hydroxy-5-(pyrrolidin-1-ylmethyl)-1H-quinolin-2-one;hydrochloride |
| SMILES | Cl.O=c1ccc2c(CN3CCCC3)c(O)ccc2[nH]1 |
| InChI | InChI=1S/C14H16N2O2.ClH/c17-13-5-4-12-10(3-6-14(18)15-12)11(13)9-16-7-1-2-8-16;/h3-6,17H,1-2,7-9H2,(H,15,18);1H |
| InChIKey | CHRSRSKKDPDRQI-UHFFFAOYSA-N |
| XLogP | 2.25 |
| TPSA | 56.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.75 |
| LogP ≤ 5 | 2.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'} |
|---|