About 3-(2-methyl-5,6-dihydrobenzo[b][1]benzazepin-11-yl)propan-1-ol
3-(2-methyl-5,6-dihydrobenzo[b][1]benzazepin-11-yl)propan-1-ol (PubChem CID 23287877) has the molecular formula C18H21NO
and a molecular weight of 267.37 g/mol. Its IUPAC name is 3-(2-methyl-5,6-dihydrobenzo[b][1]benzazepin-11-yl)propan-1-ol.
Molecular Properties
| Compound Name | 3-(2-methyl-5,6-dihydrobenzo[b][1]benzazepin-11-yl)propan-1-ol |
| PubChem CID | 23287877 |
| Molecular Formula | C18H21NO |
| Molecular Weight | 267.37 g/mol |
| Exact Mass | 267.16 |
| IUPAC Name | 3-(2-methyl-5,6-dihydrobenzo[b][1]benzazepin-11-yl)propan-1-ol |
| SMILES | Cc1ccc2c(c1)N(CCCO)c1ccccc1CC2 |
| InChI | InChI=1S/C18H21NO/c1-14-7-8-16-10-9-15-5-2-3-6-17(15)19(11-4-12-20)18(16)13-14/h2-3,5-8,13,20H,4,9-12H2,1H3 |
| InChIKey | OZOLNXOPJJMEPT-UHFFFAOYSA-N |
| XLogP | 3.61 |
| TPSA | 23.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 267.37 |
| LogP ≤ 5 | 3.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 3-(2-methyl-5,6-dihydrobenzo[b][1]benzazepin-11-yl)propan-1-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-(2-methyl-5,6-dihydrobenzo[b][1]benzazepin-11-yl)propan-1-ol?
The IUPAC name of 3-(2-methyl-5,6-dihydrobenzo[b][1]benzazepin-11-yl)propan-1-ol (CID 23287877) is 3-(2-methyl-5,6-dihydrobenzo[b][1]benzazepin-11-yl)propan-1-ol.
What is the SMILES notation for 3-(2-methyl-5,6-dihydrobenzo[b][1]benzazepin-11-yl)propan-1-ol?
The canonical SMILES for 3-(2-methyl-5,6-dihydrobenzo[b][1]benzazepin-11-yl)propan-1-ol is Cc1ccc2c(c1)N(CCCO)c1ccccc1CC2.
What is the InChIKey of 3-(2-methyl-5,6-dihydrobenzo[b][1]benzazepin-11-yl)propan-1-ol?
The InChIKey is OZOLNXOPJJMEPT-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H21NO/c1-14-7-8-16-10-9-15-5-2-3-6-17(15)19(11-4-12-20)18(16)13-14/h2-3,5-8,13,20H,4,9-12H2,1H3.
What are the key properties of 3-(2-methyl-5,6-dihydrobenzo[b][1]benzazepin-11-yl)propan-1-ol?
3-(2-methyl-5,6-dihydrobenzo[b][1]benzazepin-11-yl)propan-1-ol has a molecular weight of 267.37 g/mol, XLogP of 3.61, 3 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(2-methyl-5,6-dihydrobenzo[b][1]benzazepin-11-yl)propan-1-ol is sourced from PubChem (CID 23287877), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).