C18H16F6N2O4 — CID 2328837
1-[3,5-bis(2,2,2-trifluoroethoxy)phenyl]-3-(3-methoxyphenyl)urea (PubChem CID 2328837) has the molecular formula C18H16F6N2O4 and a molecular weight of 438.32 g/mol. Its IUPAC name is 1-[3,5-bis(2,2,2-trifluoroethoxy)phenyl]-3-(3-methoxyphenyl)urea.
| Compound Name | 1-[3,5-bis(2,2,2-trifluoroethoxy)phenyl]-3-(3-methoxyphenyl)urea |
|---|---|
| PubChem CID | 2328837 |
| Molecular Formula | C18H16F6N2O4 |
| Molecular Weight | 438.32 g/mol |
| Exact Mass | 438.10 |
| IUPAC Name | 1-[3,5-bis(2,2,2-trifluoroethoxy)phenyl]-3-(3-methoxyphenyl)urea |
| SMILES | COc1cccc(NC(=O)Nc2cc(OCC(F)(F)F)cc(OCC(F)(F)F)c2)c1 |
| InChI | InChI=1S/C18H16F6N2O4/c1-28-13-4-2-3-11(5-13)25-16(27)26-12-6-14(29-9-17(19,20)21)8-15(7-12)30-10-18(22,23)24/h2-8H,9-10H2,1H3,(H2,25,26,27) |
| InChIKey | DNZGQZLJBXMBTN-UHFFFAOYSA-N |
| XLogP | 5.22 |
| TPSA | 68.82 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.32 |
| LogP ≤ 5 | 5.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |