About 2-benzothiepine
2-benzothiepine (PubChem CID 23288949) has the molecular formula C10H8S
and a molecular weight of 160.24 g/mol. Its IUPAC name is 2-benzothiepine.
Molecular Properties
| Compound Name | 2-benzothiepine |
| PubChem CID | 23288949 |
| Molecular Formula | C10H8S |
| Molecular Weight | 160.24 g/mol |
| Exact Mass | 160.03 |
| IUPAC Name | 2-benzothiepine |
| SMILES | C1=CSC=c2ccccc2=C1 |
| InChI | InChI=1S/C10H8S/c1-2-5-10-8-11-7-3-6-9(10)4-1/h1-8H |
| InChIKey | ZWXFCATYIQTJEX-UHFFFAOYSA-N |
| XLogP | 1.47 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 160.24 |
| LogP ≤ 5 | 1.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 2-benzothiepine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-benzothiepine?
The IUPAC name of 2-benzothiepine (CID 23288949) is 2-benzothiepine.
What is the SMILES notation for 2-benzothiepine?
The canonical SMILES for 2-benzothiepine is C1=CSC=c2ccccc2=C1.
What is the InChIKey of 2-benzothiepine?
The InChIKey is ZWXFCATYIQTJEX-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H8S/c1-2-5-10-8-11-7-3-6-9(10)4-1/h1-8H.
What are the key properties of 2-benzothiepine?
2-benzothiepine has a molecular weight of 160.24 g/mol, XLogP of 1.47, 0 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 2-benzothiepine is sourced from PubChem (CID 23288949), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).