About dimethoxy-(4-methylpiperidin-1-yl)-(3,3,3-trifluoropropyl)silane
dimethoxy-(4-methylpiperidin-1-yl)-(3,3,3-trifluoropropyl)silane (PubChem CID 23289146) has the molecular formula C11H22F3NO2Si
and a molecular weight of 285.38 g/mol. Its IUPAC name is dimethoxy-(4-methylpiperidin-1-yl)-(3,3,3-trifluoropropyl)silane.
Molecular Properties
| Compound Name | dimethoxy-(4-methylpiperidin-1-yl)-(3,3,3-trifluoropropyl)silane |
| PubChem CID | 23289146 |
| Molecular Formula | C11H22F3NO2Si |
| Molecular Weight | 285.38 g/mol |
| Exact Mass | 285.14 |
| IUPAC Name | dimethoxy-(4-methylpiperidin-1-yl)-(3,3,3-trifluoropropyl)silane |
| SMILES | CO[Si](CCC(F)(F)F)(OC)N1CCC(C)CC1 |
| InChI | InChI=1S/C11H22F3NO2Si/c1-10-4-7-15(8-5-10)18(16-2,17-3)9-6-11(12,13)14/h10H,4-9H2,1-3H3 |
| InChIKey | RAYBZPINKIHRAG-UHFFFAOYSA-N |
| XLogP | 2.90 |
| TPSA | 21.70 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 285.38 |
| LogP ≤ 5 | 2.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze dimethoxy-(4-methylpiperidin-1-yl)-(3,3,3-trifluoropropyl)silane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of dimethoxy-(4-methylpiperidin-1-yl)-(3,3,3-trifluoropropyl)silane?
The IUPAC name of dimethoxy-(4-methylpiperidin-1-yl)-(3,3,3-trifluoropropyl)silane (CID 23289146) is dimethoxy-(4-methylpiperidin-1-yl)-(3,3,3-trifluoropropyl)silane.
What is the SMILES notation for dimethoxy-(4-methylpiperidin-1-yl)-(3,3,3-trifluoropropyl)silane?
The canonical SMILES for dimethoxy-(4-methylpiperidin-1-yl)-(3,3,3-trifluoropropyl)silane is CO[Si](CCC(F)(F)F)(OC)N1CCC(C)CC1.
What is the InChIKey of dimethoxy-(4-methylpiperidin-1-yl)-(3,3,3-trifluoropropyl)silane?
The InChIKey is RAYBZPINKIHRAG-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H22F3NO2Si/c1-10-4-7-15(8-5-10)18(16-2,17-3)9-6-11(12,13)14/h10H,4-9H2,1-3H3.
What are the key properties of dimethoxy-(4-methylpiperidin-1-yl)-(3,3,3-trifluoropropyl)silane?
dimethoxy-(4-methylpiperidin-1-yl)-(3,3,3-trifluoropropyl)silane has a molecular weight of 285.38 g/mol, XLogP of 2.90, 5 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for dimethoxy-(4-methylpiperidin-1-yl)-(3,3,3-trifluoropropyl)silane is sourced from PubChem (CID 23289146), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).