About 3-(2-methyl-1,3-thiazol-4-yl)phenol
3-(2-methyl-1,3-thiazol-4-yl)phenol (PubChem CID 23289294) has the molecular formula C10H9NOS
and a molecular weight of 191.25 g/mol. Its IUPAC name is 3-(2-methyl-1,3-thiazol-4-yl)phenol.
Molecular Properties
| Compound Name | 3-(2-methyl-1,3-thiazol-4-yl)phenol |
| PubChem CID | 23289294 |
| Molecular Formula | C10H9NOS |
| Molecular Weight | 191.25 g/mol |
| Exact Mass | 191.04 |
| IUPAC Name | 3-(2-methyl-1,3-thiazol-4-yl)phenol |
| SMILES | Cc1nc(-c2cccc(O)c2)cs1 |
| InChI | InChI=1S/C10H9NOS/c1-7-11-10(6-13-7)8-3-2-4-9(12)5-8/h2-6,12H,1H3 |
| InChIKey | XUTSREOVBGWBPA-UHFFFAOYSA-N |
| XLogP | 2.82 |
| TPSA | 33.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 191.25 |
| LogP ≤ 5 | 2.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 3-(2-methyl-1,3-thiazol-4-yl)phenol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-(2-methyl-1,3-thiazol-4-yl)phenol?
The IUPAC name of 3-(2-methyl-1,3-thiazol-4-yl)phenol (CID 23289294) is 3-(2-methyl-1,3-thiazol-4-yl)phenol.
What is the SMILES notation for 3-(2-methyl-1,3-thiazol-4-yl)phenol?
The canonical SMILES for 3-(2-methyl-1,3-thiazol-4-yl)phenol is Cc1nc(-c2cccc(O)c2)cs1.
What is the InChIKey of 3-(2-methyl-1,3-thiazol-4-yl)phenol?
The InChIKey is XUTSREOVBGWBPA-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H9NOS/c1-7-11-10(6-13-7)8-3-2-4-9(12)5-8/h2-6,12H,1H3.
What are the key properties of 3-(2-methyl-1,3-thiazol-4-yl)phenol?
3-(2-methyl-1,3-thiazol-4-yl)phenol has a molecular weight of 191.25 g/mol, XLogP of 2.82, 1 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(2-methyl-1,3-thiazol-4-yl)phenol is sourced from PubChem (CID 23289294), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).