C29H23F2NO2 — CID 2328982
(E)-3-[2-(difluoromethoxy)phenyl]-N-methyl-N-phenyl-2-(4-phenylphenyl)prop-2-enamide (PubChem CID 2328982) has the molecular formula C29H23F2NO2 and a molecular weight of 455.50 g/mol. Its IUPAC name is (E)-3-[2-(difluoromethoxy)phenyl]-N-methyl-N-phenyl-2-(4-phenylphenyl)prop-2-enamide.
| Compound Name | (E)-3-[2-(difluoromethoxy)phenyl]-N-methyl-N-phenyl-2-(4-phenylphenyl)prop-2-enamide |
|---|---|
| PubChem CID | 2328982 |
| Molecular Formula | C29H23F2NO2 |
| Molecular Weight | 455.50 g/mol |
| Exact Mass | 455.17 |
| IUPAC Name | (E)-3-[2-(difluoromethoxy)phenyl]-N-methyl-N-phenyl-2-(4-phenylphenyl)prop-2-enamide |
| SMILES | CN(C(=O)/C(=C/c1ccccc1OC(F)F)c1ccc(-c2ccccc2)cc1)c1ccccc1 |
| InChI | InChI=1S/C29H23F2NO2/c1-32(25-13-6-3-7-14-25)28(33)26(20-24-12-8-9-15-27(24)34-29(30)31)23-18-16-22(17-19-23)21-10-4-2-5-11-21/h2-20,29H,1H3/b26-20+ |
| InChIKey | QMUKJDYOASSRCI-LHLOQNFPSA-N |
| XLogP | 7.16 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 455.50 |
| LogP ≤ 5 | 7.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|