C20H16ClN4OS- — CID 23289842
4-(8-chloro-5H-[1]benzoxepino[4,3-b]pyridin-11-ylidene)-N-cyanopiperidine-1-carboximidothioate (PubChem CID 23289842) has the molecular formula C20H16ClN4OS- and a molecular weight of 395.90 g/mol. Its IUPAC name is 4-(8-chloro-5H-[1]benzoxepino[4,3-b]pyridin-11-ylidene)-N-cyanopiperidine-1-carboximidothioate.
| Compound Name | 4-(8-chloro-5H-[1]benzoxepino[4,3-b]pyridin-11-ylidene)-N-cyanopiperidine-1-carboximidothioate |
|---|---|
| PubChem CID | 23289842 |
| Molecular Formula | C20H16ClN4OS- |
| Molecular Weight | 395.90 g/mol |
| Exact Mass | 395.07 |
| IUPAC Name | 4-(8-chloro-5H-[1]benzoxepino[4,3-b]pyridin-11-ylidene)-N-cyanopiperidine-1-carboximidothioate |
| SMILES | N#C/N=C(\[S-])N1CCC(=C2c3ccc(Cl)cc3OCc3cccnc32)CC1 |
| InChI | InChI=1S/C20H17ClN4OS/c21-15-3-4-16-17(10-15)26-11-14-2-1-7-23-19(14)18(16)13-5-8-25(9-6-13)20(27)24-12-22/h1-4,7,10H,5-6,8-9,11H2,(H,24,27)/p-1 |
| InChIKey | GPRSLOAKDSAZMS-UHFFFAOYSA-M |
| XLogP | 3.91 |
| TPSA | 61.51 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.90 |
| LogP ≤ 5 | 3.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'cyanate_/aminonitrile_/thiocyanate', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'thiol_1', 'substructure': 'N/A'} |
|---|