About 4-methoxynaphthalene-1,6-dithiol
4-methoxynaphthalene-1,6-dithiol (PubChem CID 23290288) has the molecular formula C11H10OS2
and a molecular weight of 222.33 g/mol. Its IUPAC name is 4-methoxynaphthalene-1,6-dithiol.
Molecular Properties
| Compound Name | 4-methoxynaphthalene-1,6-dithiol |
| PubChem CID | 23290288 |
| Molecular Formula | C11H10OS2 |
| Molecular Weight | 222.33 g/mol |
| Exact Mass | 222.02 |
| IUPAC Name | 4-methoxynaphthalene-1,6-dithiol |
| SMILES | COc1ccc(S)c2ccc(S)cc12 |
| InChI | InChI=1S/C11H10OS2/c1-12-10-4-5-11(14)8-3-2-7(13)6-9(8)10/h2-6,13-14H,1H3 |
| InChIKey | OVMJWSBFYVQHQC-UHFFFAOYSA-N |
| XLogP | 3.43 |
| TPSA | 9.23 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 222.33 |
| LogP ≤ 5 | 3.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|
Analyze 4-methoxynaphthalene-1,6-dithiol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-methoxynaphthalene-1,6-dithiol?
The IUPAC name of 4-methoxynaphthalene-1,6-dithiol (CID 23290288) is 4-methoxynaphthalene-1,6-dithiol.
What is the SMILES notation for 4-methoxynaphthalene-1,6-dithiol?
The canonical SMILES for 4-methoxynaphthalene-1,6-dithiol is COc1ccc(S)c2ccc(S)cc12.
What is the InChIKey of 4-methoxynaphthalene-1,6-dithiol?
The InChIKey is OVMJWSBFYVQHQC-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H10OS2/c1-12-10-4-5-11(14)8-3-2-7(13)6-9(8)10/h2-6,13-14H,1H3.
What are the key properties of 4-methoxynaphthalene-1,6-dithiol?
4-methoxynaphthalene-1,6-dithiol has a molecular weight of 222.33 g/mol, XLogP of 3.43, 1 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4-methoxynaphthalene-1,6-dithiol is sourced from PubChem (CID 23290288), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).