C33H60N4O6 — CID 23290422
[2,2,6,6-tetramethyl-1-[2-oxo-2-[2,2,6,6-tetramethyl-1-[2-oxo-2-(2,2,6,6-tetramethylpiperidin-4-yl)oxyethyl]piperidin-4-yl]oxyethyl]piperidin-4-yl] 2-aminoacetate (PubChem CID 23290422) has the molecular formula C33H60N4O6 and a molecular weight of 608.87 g/mol. Its IUPAC name is [2,2,6,6-tetramethyl-1-[2-oxo-2-[2,2,6,6-tetramethyl-1-[2-oxo-2-(2,2,6,6-tetramethylpiperidin-4-yl)oxyethyl]piperidin-4-yl]oxyethyl]piperidin-4-yl] 2-aminoacetate.
| Compound Name | [2,2,6,6-tetramethyl-1-[2-oxo-2-[2,2,6,6-tetramethyl-1-[2-oxo-2-(2,2,6,6-tetramethylpiperidin-4-yl)oxyethyl]piperidin-4-yl]oxyethyl]piperidin-4-yl] 2-aminoacetate |
|---|---|
| PubChem CID | 23290422 |
| Molecular Formula | C33H60N4O6 |
| Molecular Weight | 608.87 g/mol |
| Exact Mass | 608.45 |
| IUPAC Name | [2,2,6,6-tetramethyl-1-[2-oxo-2-[2,2,6,6-tetramethyl-1-[2-oxo-2-(2,2,6,6-tetramethylpiperidin-4-yl)oxyethyl]piperidin-4-yl]oxyethyl]piperidin-4-yl] 2-aminoacetate |
| SMILES | CC1(C)CC(OC(=O)CN2C(C)(C)CC(OC(=O)CN3C(C)(C)CC(OC(=O)CN)CC3(C)C)CC2(C)C)CC(C)(C)N1 |
| InChI | InChI=1S/C33H60N4O6/c1-28(2)13-22(14-29(3,4)35-28)42-26(39)20-36-32(9,10)17-24(18-33(36,11)12)43-27(40)21-37-30(5,6)15-23(16-31(37,7)8)41-25(38)19-34/h22-24,35H,13-21,34H2,1-12H3 |
| InChIKey | FVGNFOBUZUNCOZ-UHFFFAOYSA-N |
| XLogP | 3.93 |
| TPSA | 123.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 43 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 608.87 |
| LogP ≤ 5 | 3.93 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|