C11H20OS — CID 23290574
2,2,6,6-tetramethyl-5-sulfanylideneheptan-3-one (PubChem CID 23290574) has the molecular formula C11H20OS and a molecular weight of 200.35 g/mol. Its IUPAC name is 2,2,6,6-tetramethyl-5-sulfanylideneheptan-3-one.
| Compound Name | 2,2,6,6-tetramethyl-5-sulfanylideneheptan-3-one |
|---|---|
| PubChem CID | 23290574 |
| Molecular Formula | C11H20OS |
| Molecular Weight | 200.35 g/mol |
| Exact Mass | 200.12 |
| IUPAC Name | 2,2,6,6-tetramethyl-5-sulfanylideneheptan-3-one |
| SMILES | CC(C)(C)C(=O)CC(=S)C(C)(C)C |
| InChI | InChI=1S/C11H20OS/c1-10(2,3)8(12)7-9(13)11(4,5)6/h7H2,1-6H3 |
| InChIKey | YUGXQDDQCYODBO-UHFFFAOYSA-N |
| XLogP | 3.41 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 200.35 |
| LogP ≤ 5 | 3.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'thio_ketone(43)', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|