C27H30N4O — CID 2329060
(4R,4aS)-4-[4-(dimethylamino)phenyl]-3,7,7-trimethyl-1-phenyl-4,4a,6,9-tetrahydropyrazolo[5,4-b]quinolin-5-one (PubChem CID 2329060) has the molecular formula C27H30N4O and a molecular weight of 426.56 g/mol. Its IUPAC name is (4R,4aS)-4-[4-(dimethylamino)phenyl]-3,7,7-trimethyl-1-phenyl-4,4a,6,9-tetrahydropyrazolo[5,4-b]quinolin-5-one.
| Compound Name | (4R,4aS)-4-[4-(dimethylamino)phenyl]-3,7,7-trimethyl-1-phenyl-4,4a,6,9-tetrahydropyrazolo[5,4-b]quinolin-5-one |
|---|---|
| PubChem CID | 2329060 |
| Molecular Formula | C27H30N4O |
| Molecular Weight | 426.56 g/mol |
| Exact Mass | 426.24 |
| IUPAC Name | (4R,4aS)-4-[4-(dimethylamino)phenyl]-3,7,7-trimethyl-1-phenyl-4,4a,6,9-tetrahydropyrazolo[5,4-b]quinolin-5-one |
| SMILES | Cc1nn(-c2ccccc2)c2c1[C@@H](c1ccc(N(C)C)cc1)[C@@H]1C(=O)CC(C)(C)C=C1N2 |
| InChI | InChI=1S/C27H30N4O/c1-17-23-24(18-11-13-19(14-12-18)30(4)5)25-21(15-27(2,3)16-22(25)32)28-26(23)31(29-17)20-9-7-6-8-10-20/h6-15,24-25,28H,16H2,1-5H3/t24-,25+/m1/s1 |
| InChIKey | GKDGAZXKJDHPRG-RPBOFIJWSA-N |
| XLogP | 5.30 |
| TPSA | 50.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.56 |
| LogP ≤ 5 | 5.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'} |
|---|