C44H48O7 — CID 23290610
2-cyclohexyl-4,6-bis[[3-ethoxy-4-hydroxy-5-[(4-hydroxyphenyl)methyl]phenyl]methyl]phenol (PubChem CID 23290610) has the molecular formula C44H48O7 and a molecular weight of 688.86 g/mol. Its IUPAC name is 2-cyclohexyl-4,6-bis[[3-ethoxy-4-hydroxy-5-[(4-hydroxyphenyl)methyl]phenyl]methyl]phenol.
| Compound Name | 2-cyclohexyl-4,6-bis[[3-ethoxy-4-hydroxy-5-[(4-hydroxyphenyl)methyl]phenyl]methyl]phenol |
|---|---|
| PubChem CID | 23290610 |
| Molecular Formula | C44H48O7 |
| Molecular Weight | 688.86 g/mol |
| Exact Mass | 688.34 |
| IUPAC Name | 2-cyclohexyl-4,6-bis[[3-ethoxy-4-hydroxy-5-[(4-hydroxyphenyl)methyl]phenyl]methyl]phenol |
| SMILES | CCOc1cc(Cc2cc(Cc3cc(Cc4ccc(O)cc4)c(O)c(OCC)c3)c(O)c(C3CCCCC3)c2)cc(Cc2ccc(O)cc2)c1O |
| InChI | InChI=1S/C44H48O7/c1-3-50-40-26-31(22-35(43(40)48)19-28-10-14-37(45)15-11-28)18-30-21-34(42(47)39(25-30)33-8-6-5-7-9-33)23-32-24-36(44(49)41(27-32)51-4-2)20-29-12-16-38(46)17-13-29/h10-17,21-22,24-27,33,45-49H,3-9,18-20,23H2,1-2H3 |
| InChIKey | JGENTWKUUFYNBH-UHFFFAOYSA-N |
| XLogP | 9.42 |
| TPSA | 119.61 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 51 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 688.86 |
| LogP ≤ 5 | 9.42 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 7 |