About 7-(3-chlorobenzoyl)azepan-2-one;7-(4-nitrobenzoyl)azepan-2-one
7-(3-chlorobenzoyl)azepan-2-one;7-(4-nitrobenzoyl)azepan-2-one (PubChem CID 23290784) has the molecular formula C26H28ClN3O6
and a molecular weight of 513.98 g/mol. Its IUPAC name is 7-(3-chlorobenzoyl)azepan-2-one;7-(4-nitrobenzoyl)azepan-2-one.
Molecular Properties
| Compound Name | 7-(3-chlorobenzoyl)azepan-2-one;7-(4-nitrobenzoyl)azepan-2-one |
| PubChem CID | 23290784 |
| Molecular Formula | C26H28ClN3O6 |
| Molecular Weight | 513.98 g/mol |
| Exact Mass | 513.17 |
| IUPAC Name | 7-(3-chlorobenzoyl)azepan-2-one;7-(4-nitrobenzoyl)azepan-2-one |
| SMILES | O=C1CCCCC(C(=O)c2ccc([N+](=O)[O-])cc2)N1.O=C1CCCCC(C(=O)c2cccc(Cl)c2)N1 |
| InChI | InChI=1S/C13H14ClNO2.C13H14N2O4/c14-10-5-3-4-9(8-10)13(17)11-6-1-2-7-12(16)15-11;16-12-4-2-1-3-11(14-12)13(17)9-5-7-10(8-6-9)15(18)19/h3-5,8,11H,1-2,6-7H2,(H,15,16);5-8,11H,1-4H2,(H,14,16) |
| InChIKey | AYEIUQYBKOMSMM-UHFFFAOYSA-N |
| XLogP | 4.42 |
| TPSA | 135.48 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 36 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 513.98 |
| LogP ≤ 5 | 4.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 7-(3-chlorobenzoyl)azepan-2-one;7-(4-nitrobenzoyl)azepan-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 7-(3-chlorobenzoyl)azepan-2-one;7-(4-nitrobenzoyl)azepan-2-one?
The IUPAC name of 7-(3-chlorobenzoyl)azepan-2-one;7-(4-nitrobenzoyl)azepan-2-one (CID 23290784) is 7-(3-chlorobenzoyl)azepan-2-one;7-(4-nitrobenzoyl)azepan-2-one.
What is the SMILES notation for 7-(3-chlorobenzoyl)azepan-2-one;7-(4-nitrobenzoyl)azepan-2-one?
The canonical SMILES for 7-(3-chlorobenzoyl)azepan-2-one;7-(4-nitrobenzoyl)azepan-2-one is O=C1CCCCC(C(=O)c2ccc([N+](=O)[O-])cc2)N1.O=C1CCCCC(C(=O)c2cccc(Cl)c2)N1.
What is the InChIKey of 7-(3-chlorobenzoyl)azepan-2-one;7-(4-nitrobenzoyl)azepan-2-one?
The InChIKey is AYEIUQYBKOMSMM-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H14ClNO2.C13H14N2O4/c14-10-5-3-4-9(8-10)13(17)11-6-1-2-7-12(16)15-11;16-12-4-2-1-3-11(14-12)13(17)9-5-7-10(8-6-9)15(18)19/h3-5,8,11H,1-2,6-7H2,(H,15,16);5-8,11H,1-4H2,(H,14,16).
What are the key properties of 7-(3-chlorobenzoyl)azepan-2-one;7-(4-nitrobenzoyl)azepan-2-one?
7-(3-chlorobenzoyl)azepan-2-one;7-(4-nitrobenzoyl)azepan-2-one has a molecular weight of 513.98 g/mol, XLogP of 4.42, 5 rotatable bonds, 2 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 7-(3-chlorobenzoyl)azepan-2-one;7-(4-nitrobenzoyl)azepan-2-one is sourced from PubChem (CID 23290784), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).