2-(2H-1,4-benzodiazepin-2-yl)acetic acid

C11H10N2O2 — CID 23291002

IUPAC2-(2H-1,4-benzodiazepin-2-yl)acetic acid
SMILESO=C(O)CC1C=NC=c2ccccc2=N1
InChIInChI=1S/C11H10N2O2/c14-11(15)5-9-7-12-6-8-3-1-2-4-10(8)13-9/h1-4,6-7,9H,5H2,(H,14,15)
InChIKeyYBVCQECBGHGDDT-UHFFFAOYSA-N
MW202.21 g/mol
LogP-0.03
Rot. Bonds2

About 2-(2H-1,4-benzodiazepin-2-yl)acetic acid

2-(2H-1,4-benzodiazepin-2-yl)acetic acid (PubChem CID 23291002) has the molecular formula C11H10N2O2 and a molecular weight of 202.21 g/mol. Its IUPAC name is 2-(2H-1,4-benzodiazepin-2-yl)acetic acid.

Molecular Properties

Compound Name2-(2H-1,4-benzodiazepin-2-yl)acetic acid
PubChem CID23291002
Molecular FormulaC11H10N2O2
Molecular Weight202.21 g/mol
Exact Mass202.07
IUPAC Name2-(2H-1,4-benzodiazepin-2-yl)acetic acid
SMILESO=C(O)CC1C=NC=c2ccccc2=N1
InChIInChI=1S/C11H10N2O2/c14-11(15)5-9-7-12-6-8-3-1-2-4-10(8)13-9/h1-4,6-7,9H,5H2,(H,14,15)
InChIKeyYBVCQECBGHGDDT-UHFFFAOYSA-N
XLogP-0.03
TPSA62.02 Ų
H-Bond Donors1
H-Bond Acceptors3
Rotatable Bonds2
Heavy Atoms15
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500202.21
LogP ≤ 5-0.03
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 103

Analyze 2-(2H-1,4-benzodiazepin-2-yl)acetic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 2-(2H-1,4-benzodiazepin-2-yl)acetic acid?
The IUPAC name of 2-(2H-1,4-benzodiazepin-2-yl)acetic acid (CID 23291002) is 2-(2H-1,4-benzodiazepin-2-yl)acetic acid.
What is the SMILES notation for 2-(2H-1,4-benzodiazepin-2-yl)acetic acid?
The canonical SMILES for 2-(2H-1,4-benzodiazepin-2-yl)acetic acid is O=C(O)CC1C=NC=c2ccccc2=N1.
What is the InChIKey of 2-(2H-1,4-benzodiazepin-2-yl)acetic acid?
The InChIKey is YBVCQECBGHGDDT-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H10N2O2/c14-11(15)5-9-7-12-6-8-3-1-2-4-10(8)13-9/h1-4,6-7,9H,5H2,(H,14,15).
What are the key properties of 2-(2H-1,4-benzodiazepin-2-yl)acetic acid?
2-(2H-1,4-benzodiazepin-2-yl)acetic acid has a molecular weight of 202.21 g/mol, XLogP of -0.03, 2 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(2H-1,4-benzodiazepin-2-yl)acetic acid is sourced from PubChem (CID 23291002), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).