C12H16N2O2 — CID 23291044
2-(8-amino-2,3,4,5-tetrahydro-1H-1-benzazepin-2-yl)acetic acid (PubChem CID 23291044) has the molecular formula C12H16N2O2 and a molecular weight of 220.27 g/mol. Its IUPAC name is 2-(8-amino-2,3,4,5-tetrahydro-1H-1-benzazepin-2-yl)acetic acid.
| Compound Name | 2-(8-amino-2,3,4,5-tetrahydro-1H-1-benzazepin-2-yl)acetic acid |
|---|---|
| PubChem CID | 23291044 |
| Molecular Formula | C12H16N2O2 |
| Molecular Weight | 220.27 g/mol |
| Exact Mass | 220.12 |
| IUPAC Name | 2-(8-amino-2,3,4,5-tetrahydro-1H-1-benzazepin-2-yl)acetic acid |
| SMILES | Nc1ccc2c(c1)NC(CC(=O)O)CCC2 |
| InChI | InChI=1S/C12H16N2O2/c13-9-5-4-8-2-1-3-10(7-12(15)16)14-11(8)6-9/h4-6,10,14H,1-3,7,13H2,(H,15,16) |
| InChIKey | BRWUBAFZMUYBSU-UHFFFAOYSA-N |
| XLogP | 1.86 |
| TPSA | 75.35 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 220.27 |
| LogP ≤ 5 | 1.86 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|