About [1-(2,2-diphenylethyl)piperidin-3-yl]methyl 4-methylbenzenesulfonate
[1-(2,2-diphenylethyl)piperidin-3-yl]methyl 4-methylbenzenesulfonate (PubChem CID 23291154) has the molecular formula C27H31NO3S
and a molecular weight of 449.62 g/mol. Its IUPAC name is [1-(2,2-diphenylethyl)piperidin-3-yl]methyl 4-methylbenzenesulfonate.
Molecular Properties
| Compound Name | [1-(2,2-diphenylethyl)piperidin-3-yl]methyl 4-methylbenzenesulfonate |
| PubChem CID | 23291154 |
| Molecular Formula | C27H31NO3S |
| Molecular Weight | 449.62 g/mol |
| Exact Mass | 449.20 |
| IUPAC Name | [1-(2,2-diphenylethyl)piperidin-3-yl]methyl 4-methylbenzenesulfonate |
| SMILES | Cc1ccc(S(=O)(=O)OCC2CCCN(CC(c3ccccc3)c3ccccc3)C2)cc1 |
| InChI | InChI=1S/C27H31NO3S/c1-22-14-16-26(17-15-22)32(29,30)31-21-23-9-8-18-28(19-23)20-27(24-10-4-2-5-11-24)25-12-6-3-7-13-25/h2-7,10-17,23,27H,8-9,18-21H2,1H3 |
| InChIKey | MTQKYVUDUJRSLH-UHFFFAOYSA-N |
| XLogP | 5.24 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 449.62 |
| LogP ≤ 5 | 5.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|
Analyze [1-(2,2-diphenylethyl)piperidin-3-yl]methyl 4-methylbenzenesulfonate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [1-(2,2-diphenylethyl)piperidin-3-yl]methyl 4-methylbenzenesulfonate?
The IUPAC name of [1-(2,2-diphenylethyl)piperidin-3-yl]methyl 4-methylbenzenesulfonate (CID 23291154) is [1-(2,2-diphenylethyl)piperidin-3-yl]methyl 4-methylbenzenesulfonate.
What is the SMILES notation for [1-(2,2-diphenylethyl)piperidin-3-yl]methyl 4-methylbenzenesulfonate?
The canonical SMILES for [1-(2,2-diphenylethyl)piperidin-3-yl]methyl 4-methylbenzenesulfonate is Cc1ccc(S(=O)(=O)OCC2CCCN(CC(c3ccccc3)c3ccccc3)C2)cc1.
What is the InChIKey of [1-(2,2-diphenylethyl)piperidin-3-yl]methyl 4-methylbenzenesulfonate?
The InChIKey is MTQKYVUDUJRSLH-UHFFFAOYSA-N. The full InChI is InChI=1S/C27H31NO3S/c1-22-14-16-26(17-15-22)32(29,30)31-21-23-9-8-18-28(19-23)20-27(24-10-4-2-5-11-24)25-12-6-3-7-13-25/h2-7,10-17,23,27H,8-9,18-21H2,1H3.
What are the key properties of [1-(2,2-diphenylethyl)piperidin-3-yl]methyl 4-methylbenzenesulfonate?
[1-(2,2-diphenylethyl)piperidin-3-yl]methyl 4-methylbenzenesulfonate has a molecular weight of 449.62 g/mol, XLogP of 5.24, 8 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for [1-(2,2-diphenylethyl)piperidin-3-yl]methyl 4-methylbenzenesulfonate is sourced from PubChem (CID 23291154), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).