C12H13N5 — CID 23291326
2,9-dimethyl-2,4,9,11-tetrazatricyclo[8.4.0.03,8]tetradeca-1(10),3(8),4,6,11,13-hexaen-5-amine (PubChem CID 23291326) has the molecular formula C12H13N5 and a molecular weight of 227.27 g/mol. Its IUPAC name is 2,9-dimethyl-2,4,9,11-tetrazatricyclo[8.4.0.03,8]tetradeca-1(10),3(8),4,6,11,13-hexaen-5-amine.
| Compound Name | 2,9-dimethyl-2,4,9,11-tetrazatricyclo[8.4.0.03,8]tetradeca-1(10),3(8),4,6,11,13-hexaen-5-amine |
|---|---|
| PubChem CID | 23291326 |
| Molecular Formula | C12H13N5 |
| Molecular Weight | 227.27 g/mol |
| Exact Mass | 227.12 |
| IUPAC Name | 2,9-dimethyl-2,4,9,11-tetrazatricyclo[8.4.0.03,8]tetradeca-1(10),3(8),4,6,11,13-hexaen-5-amine |
| SMILES | CN1c2ccc(N)nc2N(C)c2cccnc21 |
| InChI | InChI=1S/C12H13N5/c1-16-9-5-6-10(13)15-12(9)17(2)8-4-3-7-14-11(8)16/h3-7H,1-2H3,(H2,13,15) |
| InChIKey | NKPFXBXZCRRZLE-UHFFFAOYSA-N |
| XLogP | 1.91 |
| TPSA | 58.28 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 227.27 |
| LogP ≤ 5 | 1.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |