About 1-butylpiperidin-4-ol;methane
1-butylpiperidin-4-ol;methane (PubChem CID 23291440) has the molecular formula C10H23NO
and a molecular weight of 173.30 g/mol. Its IUPAC name is 1-butylpiperidin-4-ol;methane.
Molecular Properties
| Compound Name | 1-butylpiperidin-4-ol;methane |
| PubChem CID | 23291440 |
| Molecular Formula | C10H23NO |
| Molecular Weight | 173.30 g/mol |
| Exact Mass | 173.18 |
| IUPAC Name | 1-butylpiperidin-4-ol;methane |
| SMILES | C.CCCCN1CCC(O)CC1 |
| InChI | InChI=1S/C9H19NO.CH4/c1-2-3-6-10-7-4-9(11)5-8-10;/h9,11H,2-8H2,1H3;1H4 |
| InChIKey | FBNRPVPYSHJFMB-UHFFFAOYSA-N |
| XLogP | 1.88 |
| TPSA | 23.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 173.30 |
| LogP ≤ 5 | 1.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 1-butylpiperidin-4-ol;methane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-butylpiperidin-4-ol;methane?
The IUPAC name of 1-butylpiperidin-4-ol;methane (CID 23291440) is 1-butylpiperidin-4-ol;methane.
What is the SMILES notation for 1-butylpiperidin-4-ol;methane?
The canonical SMILES for 1-butylpiperidin-4-ol;methane is C.CCCCN1CCC(O)CC1.
What is the InChIKey of 1-butylpiperidin-4-ol;methane?
The InChIKey is FBNRPVPYSHJFMB-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H19NO.CH4/c1-2-3-6-10-7-4-9(11)5-8-10;/h9,11H,2-8H2,1H3;1H4.
What are the key properties of 1-butylpiperidin-4-ol;methane?
1-butylpiperidin-4-ol;methane has a molecular weight of 173.30 g/mol, XLogP of 1.88, 3 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1-butylpiperidin-4-ol;methane is sourced from PubChem (CID 23291440), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).